Print this page
OS-7753 THREAD_KPRI_RELEASE does nothing of the sort
Reviewed by: Bryan Cantrill <bryan@joyent.com>
Reviewed by: Jerry Jelinek <jerry.jelinek@joyent.com>
| Split |
Close |
| Expand all |
| Collapse all |
--- old/usr/src/uts/common/disp/fss.c
+++ new/usr/src/uts/common/disp/fss.c
1 1 /*
2 2 * CDDL HEADER START
3 3 *
4 4 * The contents of this file are subject to the terms of the
5 5 * Common Development and Distribution License (the "License").
6 6 * You may not use this file except in compliance with the License.
7 7 *
8 8 * You can obtain a copy of the license at usr/src/OPENSOLARIS.LICENSE
9 9 * or http://www.opensolaris.org/os/licensing.
10 10 * See the License for the specific language governing permissions
11 11 * and limitations under the License.
12 12 *
13 13 * When distributing Covered Code, include this CDDL HEADER in each
|
↓ open down ↓ |
13 lines elided |
↑ open up ↑ |
14 14 * file and include the License file at usr/src/OPENSOLARIS.LICENSE.
15 15 * If applicable, add the following below this CDDL HEADER, with the
16 16 * fields enclosed by brackets "[]" replaced with your own identifying
17 17 * information: Portions Copyright [yyyy] [name of copyright owner]
18 18 *
19 19 * CDDL HEADER END
20 20 */
21 21
22 22 /*
23 23 * Copyright (c) 1994, 2010, Oracle and/or its affiliates. All rights reserved.
24 - * Copyright 2013, Joyent, Inc. All rights reserved.
24 + * Copyright 2019 Joyent, Inc.
25 25 */
26 26
27 27 #include <sys/types.h>
28 28 #include <sys/param.h>
29 29 #include <sys/sysmacros.h>
30 30 #include <sys/cred.h>
31 31 #include <sys/proc.h>
32 32 #include <sys/strsubr.h>
33 33 #include <sys/priocntl.h>
34 34 #include <sys/class.h>
35 35 #include <sys/disp.h>
36 36 #include <sys/procset.h>
37 37 #include <sys/debug.h>
38 38 #include <sys/kmem.h>
39 39 #include <sys/errno.h>
40 40 #include <sys/systm.h>
41 41 #include <sys/schedctl.h>
42 42 #include <sys/vmsystm.h>
43 43 #include <sys/atomic.h>
44 44 #include <sys/project.h>
45 45 #include <sys/modctl.h>
46 46 #include <sys/fss.h>
47 47 #include <sys/fsspriocntl.h>
48 48 #include <sys/cpupart.h>
49 49 #include <sys/zone.h>
50 50 #include <vm/rm.h>
51 51 #include <vm/seg_kmem.h>
52 52 #include <sys/tnf_probe.h>
53 53 #include <sys/policy.h>
54 54 #include <sys/sdt.h>
55 55 #include <sys/cpucaps.h>
56 56
57 57 /*
58 58 * The fair share scheduling class ensures that collections of processes
59 59 * (zones and projects) each get their configured share of CPU. This is in
60 60 * contrast to the TS class which considers individual processes.
61 61 *
62 62 * The FSS cpu-share is set on zones using the zone.cpu-shares rctl and on
63 63 * projects using the project.cpu-shares rctl. By default the value is 1
64 64 * and it can range from 0 - 64k. A value of 0 means that processes in the
65 65 * collection will only get CPU resources when there are no other processes
66 66 * that need CPU. The cpu-share is used as one of the inputs to calculate a
67 67 * thread's "user-mode" priority (umdpri) for the scheduler. The umdpri falls
68 68 * in the range 0-59. FSS calculates other, internal, priorities which are not
69 69 * visible outside of the FSS class.
70 70 *
71 71 * The FSS class should approximate TS behavior when there are excess CPU
72 72 * resources. When there is a backlog of runnable processes, then the share
73 73 * is used as input into the runnable process's priority calculation, where
74 74 * the final umdpri is used by the scheduler to determine when the process runs.
75 75 *
76 76 * Projects in a zone compete with each other for CPU time, receiving CPU
77 77 * allocation within a zone proportional to the project's share; at a higher
78 78 * level zones compete with each other, receiving allocation in a pset
79 79 * proportional to the zone's share.
80 80 *
81 81 * The FSS priority calculation consists of several parts.
82 82 *
83 83 * 1) Once per second the fss_update function runs. The first thing it does is
84 84 * call fss_decay_usage. This function does three things.
85 85 *
86 86 * a) fss_decay_usage first decays the maxfsspri value for the pset. This
87 87 * value is used in the per-process priority calculation described in step
88 88 * (2b). The maxfsspri is decayed using the following formula:
89 89 *
90 90 * maxfsspri * fss_nice_decay[NZERO])
91 91 * maxfsspri = ------------------------------------
92 92 * FSS_DECAY_BASE
93 93 *
94 94 *
95 95 * - NZERO is the default process priority (i.e. 20)
96 96 *
97 97 * The fss_nice_decay array is a fixed set of values used to adjust the
98 98 * decay rate of processes based on their nice value. Entries in this
99 99 * array are initialized in fss_init using the following formula:
100 100 *
101 101 * (FSS_DECAY_MAX - FSS_DECAY_MIN) * i
102 102 * FSS_DECAY_MIN + -------------------------------------
103 103 * FSS_NICE_RANGE - 1
104 104 *
105 105 * - FSS_DECAY_MIN is 82 = approximates 65% (82/128)
106 106 * - FSS_DECAY_MAX is 108 = approximates 85% (108/128)
107 107 * - FSS_NICE_RANGE is 40 (range is 0 - 39)
108 108 *
109 109 * b) The second thing fss_decay_usage does is update each project's "usage"
110 110 * for the last second and then recalculates the project's "share usage".
111 111 *
112 112 * The usage value is the recent CPU usage for all of the threads in the
113 113 * project. It is decayed and updated this way:
114 114 *
115 115 * (usage * FSS_DECAY_USG)
116 116 * usage = ------------------------- + ticks;
117 117 * FSS_DECAY_BASE
118 118 *
119 119 * - FSS_DECAY_BASE is 128 - used instead of 100 so we can shift vs divide
120 120 * - FSS_DECAY_USG is 96 - approximates 75% (96/128)
121 121 * - ticks is updated whenever a process in this project is running
122 122 * when the scheduler's tick processing fires. This is not a simple
123 123 * counter, the values are based on the entries in the fss_nice_tick
124 124 * array (see section 3 below). ticks is then reset to 0 so it can track
125 125 * the next seconds worth of nice-adjusted time for the project.
126 126 *
127 127 * c) The third thing fss_decay_usage does is update each project's "share
128 128 * usage" (shusage). This is the normalized usage value for the project and
129 129 * is calculated this way:
130 130 *
131 131 * pset_shares^2 zone_int_shares^2
132 132 * usage * ------------- * ------------------
133 133 * kpj_shares^2 zone_ext_shares^2
134 134 *
135 135 * - usage - see (1b) for more details
136 136 * - pset_shares is the total of all *active* zone shares in the pset (by
137 137 * default there is only one pset)
138 138 * - kpj_shares is the individual project's share (project.cpu-shares rctl)
139 139 * - zone_int_shares is the sum of shares of all active projects within the
140 140 * zone (the zone-internal total)
141 141 * - zone_ext_shares is the share value for the zone (zone.cpu-shares rctl)
142 142 *
143 143 * The shusage is used in step (2b) to calculate the thread's new internal
144 144 * priority. A larger shusage value leads to a lower priority.
145 145 *
146 146 * 2) The fss_update function then calls fss_update_list to update the priority
147 147 * of all threads. This does two things.
148 148 *
149 149 * a) First the thread's internal priority is decayed using the following
150 150 * formula:
151 151 *
152 152 * fsspri * fss_nice_decay[nice_value])
153 153 * fsspri = ------------------------------------
154 154 * FSS_DECAY_BASE
155 155 *
156 156 * - FSS_DECAY_BASE is 128 as described above
157 157 *
158 158 * b) Second, if the thread is runnable (TS_RUN or TS_WAIT) calls fss_newpri
159 159 * to update the user-mode priority (umdpri) of the runnable thread.
160 160 * Threads that are running (TS_ONPROC) or waiting for an event (TS_SLEEP)
161 161 * are not updated at this time. The updated user-mode priority can cause
162 162 * threads to change their position in the run queue.
163 163 *
164 164 * The process's new internal fsspri is calculated using the following
165 165 * formula. All runnable threads in the project will use the same shusage
166 166 * and nrunnable values in their calculation.
167 167 *
168 168 * fsspri += shusage * nrunnable * ticks
169 169 *
170 170 * - shusage is the project's share usage, calculated in (1c)
171 171 * - nrunnable is the number of runnable threads in the project
172 172 * - ticks is the number of ticks this thread ran since the last fss_newpri
173 173 * invocation.
174 174 *
175 175 * Finally the process's new user-mode priority is calculated using the
176 176 * following formula:
177 177 *
178 178 * (fsspri * umdprirange)
179 179 * umdpri = maxumdpri - ------------------------
180 180 * maxfsspri
181 181 *
182 182 * - maxumdpri is MINCLSYSPRI - 1 (i.e. 59)
183 183 * - umdprirange is maxumdpri - 1 (i.e. 58)
184 184 * - maxfsspri is the largest fsspri seen so far, as we're iterating all
185 185 * runnable processes
186 186 *
187 187 * Thus, a higher internal priority (fsspri) leads to a lower user-mode
188 188 * priority which means the thread runs less. The fsspri is higher when
189 189 * the project's normalized share usage is higher, when the project has
190 190 * more runnable threads, or when the thread has accumulated more run-time.
191 191 *
192 192 * This code has various checks to ensure the resulting umdpri is in the
193 193 * range 1-59. See fss_newpri for more details.
194 194 *
195 195 * To reiterate, the above processing is performed once per second to recompute
196 196 * the runnable thread user-mode priorities.
197 197 *
198 198 * 3) The final major component in the priority calculation is the tick
199 199 * processing which occurs on a thread that is running when the clock
200 200 * calls fss_tick.
201 201 *
202 202 * A thread can run continuously in user-land (compute-bound) for the
203 203 * fss_quantum (see "dispadmin -c FSS -g" for the configurable properties).
204 204 * The fss_quantum defaults to 11 (i.e. 11 ticks).
205 205 *
206 206 * Once the quantum has been consumed, the thread will call fss_newpri to
207 207 * recompute its umdpri priority, as described above in (2b). Threads that
208 208 * were T_ONPROC at the one second interval when runnable thread priorities
209 209 * were recalculated will have their umdpri priority recalculated when their
210 210 * quanta expires.
211 211 *
212 212 * To ensure that runnable threads within a project see the expected
213 213 * round-robin behavior, there is a special case in fss_newpri for a thread
214 214 * that has run for its quanta within the one second update interval. See
215 215 * the handling for the quanta_up parameter within fss_newpri.
216 216 *
217 217 * Also of interest, the fss_tick code increments the project's tick value
218 218 * using the fss_nice_tick array entry for the thread's nice value. The idea
219 219 * behind the fss_nice_tick array is that the cost of a tick is lower at
220 220 * positive nice values (so that it doesn't increase the project's usage
221 221 * as much as normal) with a 50% drop at the maximum level and a 50%
222 222 * increase at the minimum level. See (1b). The fss_nice_tick array is
223 223 * initialized in fss_init using the following formula:
224 224 *
225 225 * FSS_TICK_COST * (((3 * FSS_NICE_RANGE) / 2) - i)
226 226 * --------------------------------------------------
227 227 * FSS_NICE_RANGE
228 228 *
229 229 * - FSS_TICK_COST is 1000, the tick cost for threads with nice level 0
230 230 *
231 231 * FSS Data Structures:
232 232 *
233 233 * fsszone
234 234 * ----- -----
235 235 * ----- | | | |
236 236 * | |-------->| |<------->| |<---->...
237 237 * | | ----- -----
238 238 * | | ^ ^ ^
239 239 * | |--- | \ \
240 240 * ----- | | \ \
241 241 * fsspset | | \ \
242 242 * | | \ \
243 243 * | ----- ----- -----
244 244 * -->| |<--->| |<--->| |
245 245 * | | | | | |
246 246 * ----- ----- -----
247 247 * fssproj
248 248 *
249 249 * That is, fsspsets contain a list of fsszone's that are currently active in
250 250 * the pset, and a list of fssproj's, corresponding to projects with runnable
251 251 * threads on the pset. fssproj's in turn point to the fsszone which they
252 252 * are a member of.
253 253 *
254 254 * An fssproj_t is removed when there are no threads in it.
255 255 *
256 256 * An fsszone_t is removed when there are no projects with threads in it.
257 257 */
258 258
259 259 static pri_t fss_init(id_t, int, classfuncs_t **);
260 260
261 261 static struct sclass fss = {
262 262 "FSS",
263 263 fss_init,
264 264 0
265 265 };
266 266
267 267 extern struct mod_ops mod_schedops;
268 268
269 269 /*
270 270 * Module linkage information for the kernel.
271 271 */
272 272 static struct modlsched modlsched = {
273 273 &mod_schedops, "fair share scheduling class", &fss
274 274 };
275 275
276 276 static struct modlinkage modlinkage = {
277 277 MODREV_1, (void *)&modlsched, NULL
278 278 };
279 279
280 280 #define FSS_MAXUPRI 60
281 281
282 282 /*
283 283 * The fssproc_t structures are kept in an array of circular doubly linked
284 284 * lists. A hash on the thread pointer is used to determine which list each
285 285 * thread should be placed in. Each list has a dummy "head" which is never
286 286 * removed, so the list is never empty. fss_update traverses these lists to
287 287 * update the priorities of threads that have been waiting on the run queue.
288 288 */
289 289 #define FSS_LISTS 16 /* number of lists, must be power of 2 */
290 290 #define FSS_LIST_HASH(t) (((uintptr_t)(t) >> 9) & (FSS_LISTS - 1))
291 291 #define FSS_LIST_NEXT(i) (((i) + 1) & (FSS_LISTS - 1))
292 292
293 293 #define FSS_LIST_INSERT(fssproc) \
294 294 { \
295 295 int index = FSS_LIST_HASH(fssproc->fss_tp); \
296 296 kmutex_t *lockp = &fss_listlock[index]; \
297 297 fssproc_t *headp = &fss_listhead[index]; \
298 298 mutex_enter(lockp); \
299 299 fssproc->fss_next = headp->fss_next; \
300 300 fssproc->fss_prev = headp; \
301 301 headp->fss_next->fss_prev = fssproc; \
302 302 headp->fss_next = fssproc; \
303 303 mutex_exit(lockp); \
304 304 }
305 305
306 306 #define FSS_LIST_DELETE(fssproc) \
307 307 { \
308 308 int index = FSS_LIST_HASH(fssproc->fss_tp); \
309 309 kmutex_t *lockp = &fss_listlock[index]; \
310 310 mutex_enter(lockp); \
311 311 fssproc->fss_prev->fss_next = fssproc->fss_next; \
312 312 fssproc->fss_next->fss_prev = fssproc->fss_prev; \
313 313 mutex_exit(lockp); \
314 314 }
315 315
316 316 #define FSS_TICK_COST 1000 /* tick cost for threads with nice level = 0 */
317 317
318 318 /*
319 319 * Decay rate percentages are based on n/128 rather than n/100 so that
320 320 * calculations can avoid having to do an integer divide by 100 (divide
321 321 * by FSS_DECAY_BASE == 128 optimizes to an arithmetic shift).
322 322 *
323 323 * FSS_DECAY_MIN = 83/128 ~= 65%
324 324 * FSS_DECAY_MAX = 108/128 ~= 85%
325 325 * FSS_DECAY_USG = 96/128 ~= 75%
326 326 */
327 327 #define FSS_DECAY_MIN 83 /* fsspri decay pct for threads w/ nice -20 */
328 328 #define FSS_DECAY_MAX 108 /* fsspri decay pct for threads w/ nice +19 */
329 329 #define FSS_DECAY_USG 96 /* fssusage decay pct for projects */
330 330 #define FSS_DECAY_BASE 128 /* base for decay percentages above */
331 331
332 332 #define FSS_NICE_MIN 0
333 333 #define FSS_NICE_MAX (2 * NZERO - 1)
334 334 #define FSS_NICE_RANGE (FSS_NICE_MAX - FSS_NICE_MIN + 1)
335 335
336 336 static int fss_nice_tick[FSS_NICE_RANGE];
337 337 static int fss_nice_decay[FSS_NICE_RANGE];
338 338
339 339 static pri_t fss_maxupri = FSS_MAXUPRI; /* maximum FSS user priority */
340 340 static pri_t fss_maxumdpri; /* maximum user mode fss priority */
341 341 static pri_t fss_maxglobpri; /* maximum global priority used by fss class */
342 342 static pri_t fss_minglobpri; /* minimum global priority */
343 343
344 344 static fssproc_t fss_listhead[FSS_LISTS];
345 345 static kmutex_t fss_listlock[FSS_LISTS];
346 346
347 347 static fsspset_t *fsspsets;
348 348 static kmutex_t fsspsets_lock; /* protects fsspsets */
349 349
350 350 static id_t fss_cid;
351 351
352 352 static time_t fss_minrun = 2; /* t_pri becomes 59 within 2 secs */
353 353 static time_t fss_minslp = 2; /* min time on sleep queue for hardswap */
354 354 static int fss_quantum = 11;
355 355
356 356 static void fss_newpri(fssproc_t *, boolean_t);
357 357 static void fss_update(void *);
358 358 static int fss_update_list(int);
359 359 static void fss_change_priority(kthread_t *, fssproc_t *);
360 360
361 361 static int fss_admin(caddr_t, cred_t *);
362 362 static int fss_getclinfo(void *);
363 363 static int fss_parmsin(void *);
364 364 static int fss_parmsout(void *, pc_vaparms_t *);
365 365 static int fss_vaparmsin(void *, pc_vaparms_t *);
366 366 static int fss_vaparmsout(void *, pc_vaparms_t *);
367 367 static int fss_getclpri(pcpri_t *);
368 368 static int fss_alloc(void **, int);
369 369 static void fss_free(void *);
370 370
371 371 static int fss_enterclass(kthread_t *, id_t, void *, cred_t *, void *);
372 372 static void fss_exitclass(void *);
373 373 static int fss_canexit(kthread_t *, cred_t *);
374 374 static int fss_fork(kthread_t *, kthread_t *, void *);
375 375 static void fss_forkret(kthread_t *, kthread_t *);
376 376 static void fss_parmsget(kthread_t *, void *);
377 377 static int fss_parmsset(kthread_t *, void *, id_t, cred_t *);
378 378 static void fss_stop(kthread_t *, int, int);
379 379 static void fss_exit(kthread_t *);
380 380 static void fss_active(kthread_t *);
381 381 static void fss_inactive(kthread_t *);
382 382 static pri_t fss_swapin(kthread_t *, int);
383 383 static pri_t fss_swapout(kthread_t *, int);
384 384 static void fss_trapret(kthread_t *);
385 385 static void fss_preempt(kthread_t *);
386 386 static void fss_setrun(kthread_t *);
387 387 static void fss_sleep(kthread_t *);
388 388 static void fss_tick(kthread_t *);
389 389 static void fss_wakeup(kthread_t *);
390 390 static int fss_donice(kthread_t *, cred_t *, int, int *);
391 391 static int fss_doprio(kthread_t *, cred_t *, int, int *);
392 392 static pri_t fss_globpri(kthread_t *);
393 393 static void fss_yield(kthread_t *);
394 394 static void fss_nullsys();
395 395
396 396 static struct classfuncs fss_classfuncs = {
397 397 /* class functions */
398 398 fss_admin,
399 399 fss_getclinfo,
400 400 fss_parmsin,
401 401 fss_parmsout,
402 402 fss_vaparmsin,
403 403 fss_vaparmsout,
404 404 fss_getclpri,
405 405 fss_alloc,
406 406 fss_free,
407 407
408 408 /* thread functions */
409 409 fss_enterclass,
410 410 fss_exitclass,
411 411 fss_canexit,
412 412 fss_fork,
413 413 fss_forkret,
414 414 fss_parmsget,
415 415 fss_parmsset,
416 416 fss_stop,
417 417 fss_exit,
418 418 fss_active,
419 419 fss_inactive,
420 420 fss_swapin,
421 421 fss_swapout,
422 422 fss_trapret,
423 423 fss_preempt,
424 424 fss_setrun,
425 425 fss_sleep,
426 426 fss_tick,
427 427 fss_wakeup,
428 428 fss_donice,
429 429 fss_globpri,
430 430 fss_nullsys, /* set_process_group */
431 431 fss_yield,
432 432 fss_doprio,
433 433 };
434 434
435 435 int
436 436 _init()
437 437 {
438 438 return (mod_install(&modlinkage));
439 439 }
440 440
441 441 int
442 442 _fini()
443 443 {
444 444 return (EBUSY);
445 445 }
446 446
447 447 int
448 448 _info(struct modinfo *modinfop)
449 449 {
450 450 return (mod_info(&modlinkage, modinfop));
451 451 }
452 452
453 453 /*ARGSUSED*/
454 454 static int
455 455 fss_project_walker(kproject_t *kpj, void *buf)
456 456 {
457 457 return (0);
458 458 }
459 459
460 460 void *
461 461 fss_allocbuf(int op, int type)
462 462 {
463 463 fssbuf_t *fssbuf;
464 464 void **fsslist;
465 465 int cnt;
466 466 int i;
467 467 size_t size;
468 468
469 469 ASSERT(op == FSS_NPSET_BUF || op == FSS_NPROJ_BUF || op == FSS_ONE_BUF);
470 470 ASSERT(type == FSS_ALLOC_PROJ || type == FSS_ALLOC_ZONE);
471 471 ASSERT(MUTEX_HELD(&cpu_lock));
472 472
473 473 fssbuf = kmem_zalloc(sizeof (fssbuf_t), KM_SLEEP);
474 474 switch (op) {
475 475 case FSS_NPSET_BUF:
476 476 cnt = cpupart_list(NULL, 0, CP_NONEMPTY);
477 477 break;
478 478 case FSS_NPROJ_BUF:
479 479 cnt = project_walk_all(ALL_ZONES, fss_project_walker, NULL);
480 480 break;
481 481 case FSS_ONE_BUF:
482 482 cnt = 1;
483 483 break;
484 484 }
485 485
486 486 switch (type) {
487 487 case FSS_ALLOC_PROJ:
488 488 size = sizeof (fssproj_t);
489 489 break;
490 490 case FSS_ALLOC_ZONE:
491 491 size = sizeof (fsszone_t);
492 492 break;
493 493 }
494 494 fsslist = kmem_zalloc(cnt * sizeof (void *), KM_SLEEP);
495 495 fssbuf->fssb_size = cnt;
496 496 fssbuf->fssb_list = fsslist;
497 497 for (i = 0; i < cnt; i++)
498 498 fsslist[i] = kmem_zalloc(size, KM_SLEEP);
499 499 return (fssbuf);
500 500 }
501 501
502 502 void
503 503 fss_freebuf(fssbuf_t *fssbuf, int type)
504 504 {
505 505 void **fsslist;
506 506 int i;
507 507 size_t size;
508 508
509 509 ASSERT(fssbuf != NULL);
510 510 ASSERT(type == FSS_ALLOC_PROJ || type == FSS_ALLOC_ZONE);
511 511 fsslist = fssbuf->fssb_list;
512 512
513 513 switch (type) {
514 514 case FSS_ALLOC_PROJ:
515 515 size = sizeof (fssproj_t);
516 516 break;
517 517 case FSS_ALLOC_ZONE:
518 518 size = sizeof (fsszone_t);
519 519 break;
520 520 }
521 521
522 522 for (i = 0; i < fssbuf->fssb_size; i++) {
523 523 if (fsslist[i] != NULL)
524 524 kmem_free(fsslist[i], size);
525 525 }
526 526 kmem_free(fsslist, sizeof (void *) * fssbuf->fssb_size);
527 527 kmem_free(fssbuf, sizeof (fssbuf_t));
528 528 }
529 529
530 530 static fsspset_t *
531 531 fss_find_fsspset(cpupart_t *cpupart)
532 532 {
533 533 int i;
534 534 fsspset_t *fsspset = NULL;
535 535 int found = 0;
536 536
537 537 ASSERT(cpupart != NULL);
538 538 ASSERT(MUTEX_HELD(&fsspsets_lock));
539 539
540 540 /*
541 541 * Search for the cpupart pointer in the array of fsspsets.
542 542 */
543 543 for (i = 0; i < max_ncpus; i++) {
544 544 fsspset = &fsspsets[i];
545 545 if (fsspset->fssps_cpupart == cpupart) {
546 546 ASSERT(fsspset->fssps_nproj > 0);
547 547 found = 1;
548 548 break;
549 549 }
550 550 }
551 551 if (found == 0) {
552 552 /*
553 553 * If we didn't find anything, then use the first
554 554 * available slot in the fsspsets array.
555 555 */
556 556 for (i = 0; i < max_ncpus; i++) {
557 557 fsspset = &fsspsets[i];
558 558 if (fsspset->fssps_cpupart == NULL) {
559 559 ASSERT(fsspset->fssps_nproj == 0);
560 560 found = 1;
561 561 break;
562 562 }
563 563 }
564 564 fsspset->fssps_cpupart = cpupart;
565 565 }
566 566 ASSERT(found == 1);
567 567 return (fsspset);
568 568 }
569 569
570 570 static void
571 571 fss_del_fsspset(fsspset_t *fsspset)
572 572 {
573 573 ASSERT(MUTEX_HELD(&fsspsets_lock));
574 574 ASSERT(MUTEX_HELD(&fsspset->fssps_lock));
575 575 ASSERT(fsspset->fssps_nproj == 0);
576 576 ASSERT(fsspset->fssps_list == NULL);
577 577 ASSERT(fsspset->fssps_zones == NULL);
578 578 fsspset->fssps_cpupart = NULL;
579 579 fsspset->fssps_maxfsspri = 0;
580 580 fsspset->fssps_shares = 0;
581 581 }
582 582
583 583 /*
584 584 * The following routine returns a pointer to the fsszone structure which
585 585 * belongs to zone "zone" and cpu partition fsspset, if such structure exists.
586 586 */
587 587 static fsszone_t *
588 588 fss_find_fsszone(fsspset_t *fsspset, zone_t *zone)
589 589 {
590 590 fsszone_t *fsszone;
591 591
592 592 ASSERT(MUTEX_HELD(&fsspset->fssps_lock));
593 593
594 594 if (fsspset->fssps_list != NULL) {
595 595 /*
596 596 * There are projects/zones active on this cpu partition
597 597 * already. Try to find our zone among them.
598 598 */
599 599 fsszone = fsspset->fssps_zones;
600 600 do {
601 601 if (fsszone->fssz_zone == zone) {
602 602 return (fsszone);
603 603 }
604 604 fsszone = fsszone->fssz_next;
605 605 } while (fsszone != fsspset->fssps_zones);
606 606 }
607 607 return (NULL);
608 608 }
609 609
610 610 /*
611 611 * The following routine links new fsszone structure into doubly linked list of
612 612 * zones active on the specified cpu partition.
613 613 */
614 614 static void
615 615 fss_insert_fsszone(fsspset_t *fsspset, zone_t *zone, fsszone_t *fsszone)
616 616 {
617 617 ASSERT(MUTEX_HELD(&fsspset->fssps_lock));
618 618
619 619 fsszone->fssz_zone = zone;
620 620 fsszone->fssz_rshares = zone->zone_shares;
621 621
622 622 if (fsspset->fssps_zones == NULL) {
623 623 /*
624 624 * This will be the first fsszone for this fsspset
625 625 */
626 626 fsszone->fssz_next = fsszone->fssz_prev = fsszone;
627 627 fsspset->fssps_zones = fsszone;
628 628 } else {
629 629 /*
630 630 * Insert this fsszone to the doubly linked list.
631 631 */
632 632 fsszone_t *fssz_head = fsspset->fssps_zones;
633 633
634 634 fsszone->fssz_next = fssz_head;
635 635 fsszone->fssz_prev = fssz_head->fssz_prev;
636 636 fssz_head->fssz_prev->fssz_next = fsszone;
637 637 fssz_head->fssz_prev = fsszone;
638 638 fsspset->fssps_zones = fsszone;
639 639 }
640 640 }
641 641
642 642 /*
643 643 * The following routine removes a single fsszone structure from the doubly
644 644 * linked list of zones active on the specified cpu partition. Note that
645 645 * global fsspsets_lock must be held in case this fsszone structure is the last
646 646 * on the above mentioned list. Also note that the fsszone structure is not
647 647 * freed here, it is the responsibility of the caller to call kmem_free for it.
648 648 */
649 649 static void
650 650 fss_remove_fsszone(fsspset_t *fsspset, fsszone_t *fsszone)
651 651 {
652 652 ASSERT(MUTEX_HELD(&fsspset->fssps_lock));
653 653 ASSERT(fsszone->fssz_nproj == 0);
654 654 ASSERT(fsszone->fssz_shares == 0);
655 655 ASSERT(fsszone->fssz_runnable == 0);
656 656
657 657 if (fsszone->fssz_next != fsszone) {
658 658 /*
659 659 * This is not the last zone in the list.
660 660 */
661 661 fsszone->fssz_prev->fssz_next = fsszone->fssz_next;
662 662 fsszone->fssz_next->fssz_prev = fsszone->fssz_prev;
663 663 if (fsspset->fssps_zones == fsszone)
664 664 fsspset->fssps_zones = fsszone->fssz_next;
665 665 } else {
666 666 /*
667 667 * This was the last zone active in this cpu partition.
668 668 */
669 669 fsspset->fssps_zones = NULL;
670 670 }
671 671 }
672 672
673 673 /*
674 674 * The following routine returns a pointer to the fssproj structure
675 675 * which belongs to project kpj and cpu partition fsspset, if such structure
676 676 * exists.
677 677 */
678 678 static fssproj_t *
679 679 fss_find_fssproj(fsspset_t *fsspset, kproject_t *kpj)
680 680 {
681 681 fssproj_t *fssproj;
682 682
683 683 ASSERT(MUTEX_HELD(&fsspset->fssps_lock));
684 684
685 685 if (fsspset->fssps_list != NULL) {
686 686 /*
687 687 * There are projects running on this cpu partition already.
688 688 * Try to find our project among them.
689 689 */
690 690 fssproj = fsspset->fssps_list;
691 691 do {
692 692 if (fssproj->fssp_proj == kpj) {
693 693 ASSERT(fssproj->fssp_pset == fsspset);
694 694 return (fssproj);
695 695 }
696 696 fssproj = fssproj->fssp_next;
697 697 } while (fssproj != fsspset->fssps_list);
698 698 }
699 699 return (NULL);
700 700 }
701 701
702 702 /*
703 703 * The following routine links new fssproj structure into doubly linked list
704 704 * of projects running on the specified cpu partition.
705 705 */
706 706 static void
707 707 fss_insert_fssproj(fsspset_t *fsspset, kproject_t *kpj, fsszone_t *fsszone,
708 708 fssproj_t *fssproj)
709 709 {
710 710 ASSERT(MUTEX_HELD(&fsspset->fssps_lock));
711 711
712 712 fssproj->fssp_pset = fsspset;
713 713 fssproj->fssp_proj = kpj;
714 714 fssproj->fssp_shares = kpj->kpj_shares;
715 715
716 716 fsspset->fssps_nproj++;
717 717
718 718 if (fsspset->fssps_list == NULL) {
719 719 /*
720 720 * This will be the first fssproj for this fsspset
721 721 */
722 722 fssproj->fssp_next = fssproj->fssp_prev = fssproj;
723 723 fsspset->fssps_list = fssproj;
724 724 } else {
725 725 /*
726 726 * Insert this fssproj to the doubly linked list.
727 727 */
728 728 fssproj_t *fssp_head = fsspset->fssps_list;
729 729
730 730 fssproj->fssp_next = fssp_head;
731 731 fssproj->fssp_prev = fssp_head->fssp_prev;
732 732 fssp_head->fssp_prev->fssp_next = fssproj;
733 733 fssp_head->fssp_prev = fssproj;
734 734 fsspset->fssps_list = fssproj;
735 735 }
736 736 fssproj->fssp_fsszone = fsszone;
737 737 fsszone->fssz_nproj++;
738 738 ASSERT(fsszone->fssz_nproj != 0);
739 739 }
740 740
741 741 /*
742 742 * The following routine removes a single fssproj structure from the doubly
743 743 * linked list of projects running on the specified cpu partition. Note that
744 744 * global fsspsets_lock must be held in case if this fssproj structure is the
745 745 * last on the above mentioned list. Also note that the fssproj structure is
746 746 * not freed here, it is the responsibility of the caller to call kmem_free
747 747 * for it.
748 748 */
749 749 static void
750 750 fss_remove_fssproj(fsspset_t *fsspset, fssproj_t *fssproj)
751 751 {
752 752 fsszone_t *fsszone;
753 753
754 754 ASSERT(MUTEX_HELD(&fsspsets_lock));
755 755 ASSERT(MUTEX_HELD(&fsspset->fssps_lock));
756 756 ASSERT(fssproj->fssp_runnable == 0);
757 757
758 758 fsspset->fssps_nproj--;
759 759
760 760 fsszone = fssproj->fssp_fsszone;
761 761 fsszone->fssz_nproj--;
762 762
763 763 if (fssproj->fssp_next != fssproj) {
764 764 /*
765 765 * This is not the last part in the list.
766 766 */
767 767 fssproj->fssp_prev->fssp_next = fssproj->fssp_next;
768 768 fssproj->fssp_next->fssp_prev = fssproj->fssp_prev;
769 769 if (fsspset->fssps_list == fssproj)
770 770 fsspset->fssps_list = fssproj->fssp_next;
771 771 if (fsszone->fssz_nproj == 0)
772 772 fss_remove_fsszone(fsspset, fsszone);
773 773 } else {
774 774 /*
775 775 * This was the last project part running
776 776 * at this cpu partition.
777 777 */
778 778 fsspset->fssps_list = NULL;
779 779 ASSERT(fsspset->fssps_nproj == 0);
780 780 ASSERT(fsszone->fssz_nproj == 0);
781 781 fss_remove_fsszone(fsspset, fsszone);
782 782 fss_del_fsspset(fsspset);
783 783 }
784 784 }
785 785
786 786 static void
787 787 fss_inactive(kthread_t *t)
788 788 {
789 789 fssproc_t *fssproc;
790 790 fssproj_t *fssproj;
791 791 fsspset_t *fsspset;
792 792 fsszone_t *fsszone;
793 793
794 794 ASSERT(THREAD_LOCK_HELD(t));
795 795 fssproc = FSSPROC(t);
796 796 fssproj = FSSPROC2FSSPROJ(fssproc);
797 797 if (fssproj == NULL) /* if this thread already exited */
798 798 return;
799 799 fsspset = FSSPROJ2FSSPSET(fssproj);
800 800 fsszone = fssproj->fssp_fsszone;
801 801 disp_lock_enter_high(&fsspset->fssps_displock);
802 802 ASSERT(fssproj->fssp_runnable > 0);
803 803 if (--fssproj->fssp_runnable == 0) {
804 804 fsszone->fssz_shares -= fssproj->fssp_shares;
805 805 if (--fsszone->fssz_runnable == 0)
806 806 fsspset->fssps_shares -= fsszone->fssz_rshares;
807 807 }
808 808 ASSERT(fssproc->fss_runnable == 1);
809 809 fssproc->fss_runnable = 0;
810 810 disp_lock_exit_high(&fsspset->fssps_displock);
811 811 }
812 812
813 813 static void
814 814 fss_active(kthread_t *t)
815 815 {
816 816 fssproc_t *fssproc;
817 817 fssproj_t *fssproj;
818 818 fsspset_t *fsspset;
819 819 fsszone_t *fsszone;
820 820
821 821 ASSERT(THREAD_LOCK_HELD(t));
822 822 fssproc = FSSPROC(t);
823 823 fssproj = FSSPROC2FSSPROJ(fssproc);
824 824 if (fssproj == NULL) /* if this thread already exited */
825 825 return;
826 826 fsspset = FSSPROJ2FSSPSET(fssproj);
827 827 fsszone = fssproj->fssp_fsszone;
828 828 disp_lock_enter_high(&fsspset->fssps_displock);
829 829 if (++fssproj->fssp_runnable == 1) {
830 830 fsszone->fssz_shares += fssproj->fssp_shares;
831 831 if (++fsszone->fssz_runnable == 1)
832 832 fsspset->fssps_shares += fsszone->fssz_rshares;
833 833 }
834 834 ASSERT(fssproc->fss_runnable == 0);
835 835 fssproc->fss_runnable = 1;
836 836 disp_lock_exit_high(&fsspset->fssps_displock);
837 837 }
838 838
839 839 /*
840 840 * Fair share scheduler initialization. Called by dispinit() at boot time.
841 841 * We can ignore clparmsz argument since we know that the smallest possible
842 842 * parameter buffer is big enough for us.
843 843 */
844 844 /*ARGSUSED*/
845 845 static pri_t
846 846 fss_init(id_t cid, int clparmsz, classfuncs_t **clfuncspp)
847 847 {
848 848 int i;
849 849
850 850 ASSERT(MUTEX_HELD(&cpu_lock));
851 851
852 852 fss_cid = cid;
853 853 fss_maxumdpri = minclsyspri - 1;
854 854 fss_maxglobpri = minclsyspri;
855 855 fss_minglobpri = 0;
856 856 fsspsets = kmem_zalloc(sizeof (fsspset_t) * max_ncpus, KM_SLEEP);
857 857
858 858 /*
859 859 * Initialize the fssproc hash table.
860 860 */
861 861 for (i = 0; i < FSS_LISTS; i++)
862 862 fss_listhead[i].fss_next = fss_listhead[i].fss_prev =
863 863 &fss_listhead[i];
864 864
865 865 *clfuncspp = &fss_classfuncs;
866 866
867 867 /*
868 868 * Fill in fss_nice_tick and fss_nice_decay arrays:
869 869 * The cost of a tick is lower at positive nice values (so that it
870 870 * will not increase its project's usage as much as normal) with 50%
871 871 * drop at the maximum level and 50% increase at the minimum level.
872 872 * The fsspri decay is slower at positive nice values. fsspri values
873 873 * of processes with negative nice levels must decay faster to receive
874 874 * time slices more frequently than normal.
875 875 */
876 876 for (i = 0; i < FSS_NICE_RANGE; i++) {
877 877 fss_nice_tick[i] = (FSS_TICK_COST * (((3 * FSS_NICE_RANGE) / 2)
878 878 - i)) / FSS_NICE_RANGE;
879 879 fss_nice_decay[i] = FSS_DECAY_MIN +
880 880 ((FSS_DECAY_MAX - FSS_DECAY_MIN) * i) /
881 881 (FSS_NICE_RANGE - 1);
882 882 }
883 883
884 884 return (fss_maxglobpri);
885 885 }
886 886
887 887 /*
888 888 * Calculate the new fss_umdpri based on the usage, the normalized share usage
889 889 * and the number of active threads. Reset the tick counter for this thread.
890 890 *
891 891 * When calculating the new priority using the standard formula we can hit
892 892 * a scenario where we don't have good round-robin behavior. This would be
893 893 * most commonly seen when there is a zone with lots of runnable threads.
894 894 * In the bad scenario we will see the following behavior when using the
895 895 * standard formula and these conditions:
896 896 *
897 897 * - there are multiple runnable threads in the zone (project)
898 898 * - the fssps_maxfsspri is a very large value
899 899 * - (we also know all of these threads will use the project's
900 900 * fssp_shusage)
901 901 *
902 902 * Under these conditions, a thread with a low fss_fsspri value is chosen
903 903 * to run and the thread gets a high fss_umdpri. This thread can run for
904 904 * its full quanta (fss_timeleft) at which time fss_newpri is called to
905 905 * calculate the thread's new priority.
906 906 *
907 907 * In this case, because the newly calculated fsspri value is much smaller
908 908 * (orders of magnitude) than the fssps_maxfsspri value, if we used the
909 909 * standard formula the thread will still get a high fss_umdpri value and
910 910 * will run again for another quanta, even though there are other runnable
911 911 * threads in the project.
912 912 *
913 913 * For a thread that is runnable for a long time, the thread can continue
914 914 * to run for many quanta (totaling many seconds) before the thread's fsspri
915 915 * exceeds the fssps_maxfsspri and the thread's fss_umdpri is reset back
916 916 * down to 1. This behavior also keeps the fssps_maxfsspr at a high value,
917 917 * so that the next runnable thread might repeat this cycle.
918 918 *
919 919 * This leads to the case where we don't have round-robin behavior at quanta
920 920 * granularity, but instead, runnable threads within the project only run
921 921 * at several second intervals.
922 922 *
923 923 * To prevent this scenario from occuring, when a thread has consumed its
924 924 * quanta and there are multiple runnable threads in the project, we
925 925 * immediately cause the thread to hit fssps_maxfsspri so that it gets
926 926 * reset back to 1 and another runnable thread in the project can run.
927 927 */
928 928 static void
929 929 fss_newpri(fssproc_t *fssproc, boolean_t quanta_up)
930 930 {
931 931 kthread_t *tp;
932 932 fssproj_t *fssproj;
933 933 fsspset_t *fsspset;
934 934 fsszone_t *fsszone;
935 935 fsspri_t fsspri, maxfsspri;
936 936 uint32_t n_runnable;
937 937 pri_t invpri;
938 938 uint32_t ticks;
939 939
940 940 tp = fssproc->fss_tp;
941 941 ASSERT(tp != NULL);
942 942
943 943 if (tp->t_cid != fss_cid)
944 944 return;
945 945
946 946 ASSERT(THREAD_LOCK_HELD(tp));
947 947
948 948 fssproj = FSSPROC2FSSPROJ(fssproc);
949 949 fsszone = FSSPROJ2FSSZONE(fssproj);
950 950 if (fssproj == NULL)
951 951 /*
952 952 * No need to change priority of exited threads.
953 953 */
954 954 return;
955 955
956 956 fsspset = FSSPROJ2FSSPSET(fssproj);
957 957 disp_lock_enter_high(&fsspset->fssps_displock);
958 958
959 959 ticks = fssproc->fss_ticks;
960 960 fssproc->fss_ticks = 0;
961 961
962 962 if (fssproj->fssp_shares == 0 || fsszone->fssz_rshares == 0) {
963 963 /*
964 964 * Special case: threads with no shares.
965 965 */
966 966 fssproc->fss_umdpri = fss_minglobpri;
967 967 disp_lock_exit_high(&fsspset->fssps_displock);
968 968 return;
969 969 }
970 970
971 971 maxfsspri = fsspset->fssps_maxfsspri;
972 972 n_runnable = fssproj->fssp_runnable;
973 973
974 974 if (quanta_up && n_runnable > 1) {
975 975 fsspri = maxfsspri;
976 976 } else {
977 977 /*
978 978 * fsspri += fssp_shusage * nrunnable * ticks
979 979 * If all three values are non-0, this typically calculates to
980 980 * a large number (sometimes > 1M, sometimes > 100B) due to
981 981 * fssp_shusage which can be > 1T.
982 982 */
983 983 fsspri = fssproc->fss_fsspri;
984 984 fsspri += fssproj->fssp_shusage * n_runnable * ticks;
985 985 }
986 986
987 987 fssproc->fss_fsspri = fsspri;
988 988
989 989 /*
990 990 * fss_maxumdpri is normally 59, since FSS priorities are 0-59.
991 991 * If the previous calculation resulted in 0 (e.g. was 0 and added 0
992 992 * because ticks == 0), then instead of 0, we use the largest priority,
993 993 * which is still small in comparison to the large numbers we typically
994 994 * see.
995 995 */
996 996 if (fsspri < fss_maxumdpri)
997 997 fsspri = fss_maxumdpri; /* so that maxfsspri is != 0 */
998 998
999 999 /*
1000 1000 * The general priority formula:
1001 1001 *
1002 1002 * (fsspri * umdprirange)
1003 1003 * pri = maxumdpri - ------------------------
1004 1004 * maxfsspri
1005 1005 *
1006 1006 * If this thread's fsspri is greater than the previous largest
1007 1007 * fsspri, then record it as the new high and priority for this
1008 1008 * thread will be one (the lowest priority assigned to a thread
1009 1009 * that has non-zero shares). Because of this check, maxfsspri can
1010 1010 * change as this function is called via the
1011 1011 * fss_update -> fss_update_list -> fss_newpri code path to update
1012 1012 * all runnable threads. See the code in fss_update for how we
1013 1013 * mitigate this issue.
1014 1014 *
1015 1015 * Note that this formula cannot produce out of bounds priority
1016 1016 * values (0-59); if it is changed, additional checks may need to be
1017 1017 * added.
1018 1018 */
1019 1019 if (fsspri >= maxfsspri) {
1020 1020 fsspset->fssps_maxfsspri = fsspri;
1021 1021 disp_lock_exit_high(&fsspset->fssps_displock);
1022 1022 fssproc->fss_umdpri = 1;
1023 1023 } else {
1024 1024 disp_lock_exit_high(&fsspset->fssps_displock);
1025 1025 invpri = (fsspri * (fss_maxumdpri - 1)) / maxfsspri;
1026 1026 fssproc->fss_umdpri = fss_maxumdpri - invpri;
1027 1027 }
1028 1028 }
1029 1029
1030 1030 /*
1031 1031 * Decays usages of all running projects, resets their tick counters and
1032 1032 * calcluates the projects normalized share usage. Called once per second from
1033 1033 * fss_update().
1034 1034 */
1035 1035 static void
1036 1036 fss_decay_usage()
1037 1037 {
1038 1038 uint32_t zone_ext_shares, zone_int_shares;
1039 1039 uint32_t kpj_shares, pset_shares;
1040 1040 fsspset_t *fsspset;
1041 1041 fssproj_t *fssproj;
1042 1042 fsszone_t *fsszone;
1043 1043 fsspri_t maxfsspri;
1044 1044 int psetid;
1045 1045 struct zone *zp;
1046 1046
1047 1047 mutex_enter(&fsspsets_lock);
1048 1048 /*
1049 1049 * Go through all active processor sets and decay usages of projects
1050 1050 * running on them.
1051 1051 */
1052 1052 for (psetid = 0; psetid < max_ncpus; psetid++) {
1053 1053 fsspset = &fsspsets[psetid];
1054 1054 mutex_enter(&fsspset->fssps_lock);
1055 1055
1056 1056 fsspset->fssps_gen++;
1057 1057
1058 1058 if (fsspset->fssps_cpupart == NULL ||
1059 1059 (fssproj = fsspset->fssps_list) == NULL) {
1060 1060 mutex_exit(&fsspset->fssps_lock);
1061 1061 continue;
1062 1062 }
1063 1063
1064 1064 /*
1065 1065 * Decay maxfsspri for this cpu partition with the
1066 1066 * fastest possible decay rate.
1067 1067 */
1068 1068 disp_lock_enter(&fsspset->fssps_displock);
1069 1069
1070 1070 pset_shares = fsspset->fssps_shares;
1071 1071
1072 1072 maxfsspri = (fsspset->fssps_maxfsspri *
1073 1073 fss_nice_decay[NZERO]) / FSS_DECAY_BASE;
1074 1074 if (maxfsspri < fss_maxumdpri)
1075 1075 maxfsspri = fss_maxumdpri;
1076 1076 fsspset->fssps_maxfsspri = maxfsspri;
1077 1077
1078 1078 do {
1079 1079 fsszone = fssproj->fssp_fsszone;
1080 1080 zp = fsszone->fssz_zone;
1081 1081
1082 1082 /*
1083 1083 * Reset zone's FSS stats if they are from a
1084 1084 * previous cycle.
1085 1085 */
1086 1086 if (fsspset->fssps_gen != zp->zone_fss_gen) {
1087 1087 zp->zone_fss_gen = fsspset->fssps_gen;
1088 1088 zp->zone_run_ticks = 0;
1089 1089 }
1090 1090
1091 1091 /*
1092 1092 * Decay project usage, then add in this cycle's
1093 1093 * nice tick value.
1094 1094 */
1095 1095 fssproj->fssp_usage =
1096 1096 (fssproj->fssp_usage * FSS_DECAY_USG) /
1097 1097 FSS_DECAY_BASE +
1098 1098 fssproj->fssp_ticks;
1099 1099
1100 1100 fssproj->fssp_ticks = 0;
1101 1101 zp->zone_run_ticks += fssproj->fssp_tick_cnt;
1102 1102 fssproj->fssp_tick_cnt = 0;
1103 1103
1104 1104 /*
1105 1105 * Readjust the project's number of shares if it has
1106 1106 * changed since we checked it last time.
1107 1107 */
1108 1108 kpj_shares = fssproj->fssp_proj->kpj_shares;
1109 1109 if (fssproj->fssp_shares != kpj_shares) {
1110 1110 if (fssproj->fssp_runnable != 0) {
1111 1111 fsszone->fssz_shares -=
1112 1112 fssproj->fssp_shares;
1113 1113 fsszone->fssz_shares += kpj_shares;
1114 1114 }
1115 1115 fssproj->fssp_shares = kpj_shares;
1116 1116 }
1117 1117
1118 1118 /*
1119 1119 * Readjust the zone's number of shares if it
1120 1120 * has changed since we checked it last time.
1121 1121 */
1122 1122 zone_ext_shares = zp->zone_shares;
1123 1123 if (fsszone->fssz_rshares != zone_ext_shares) {
1124 1124 if (fsszone->fssz_runnable != 0) {
1125 1125 fsspset->fssps_shares -=
1126 1126 fsszone->fssz_rshares;
1127 1127 fsspset->fssps_shares +=
1128 1128 zone_ext_shares;
1129 1129 pset_shares = fsspset->fssps_shares;
1130 1130 }
1131 1131 fsszone->fssz_rshares = zone_ext_shares;
1132 1132 }
1133 1133 zone_int_shares = fsszone->fssz_shares;
1134 1134
1135 1135 /*
1136 1136 * If anything is runnable in the project, track the
1137 1137 * overall project share percent for monitoring useage.
1138 1138 */
1139 1139 if (fssproj->fssp_runnable > 0) {
1140 1140 uint32_t zone_shr_pct;
1141 1141 uint32_t int_shr_pct;
1142 1142
1143 1143 /*
1144 1144 * Times 1000 to get tenths of a percent
1145 1145 *
1146 1146 * zone_ext_shares
1147 1147 * zone_shr_pct = ---------------
1148 1148 * pset_shares
1149 1149 *
1150 1150 * kpj_shares
1151 1151 * int_shr_pct = ---------------
1152 1152 * zone_int_shares
1153 1153 */
1154 1154 if (pset_shares == 0 || zone_int_shares == 0) {
1155 1155 fssproj->fssp_shr_pct = 0;
1156 1156 } else {
1157 1157 zone_shr_pct =
1158 1158 (zone_ext_shares * 1000) /
1159 1159 pset_shares;
1160 1160 int_shr_pct = (kpj_shares * 1000) /
1161 1161 zone_int_shares;
1162 1162 fssproj->fssp_shr_pct =
1163 1163 (zone_shr_pct * int_shr_pct) /
1164 1164 1000;
1165 1165 }
1166 1166 } else {
1167 1167 DTRACE_PROBE1(fss__prj__norun, fssproj_t *,
1168 1168 fssproj);
1169 1169 }
1170 1170
1171 1171 /*
1172 1172 * Calculate fssp_shusage value to be used
1173 1173 * for fsspri increments for the next second.
1174 1174 */
1175 1175 if (kpj_shares == 0 || zone_ext_shares == 0) {
1176 1176 fssproj->fssp_shusage = 0;
1177 1177 } else if (FSSPROJ2KPROJ(fssproj) == proj0p) {
1178 1178 uint32_t zone_shr_pct;
1179 1179
1180 1180 /*
1181 1181 * Project 0 in the global zone has 50%
1182 1182 * of its zone. See calculation above for
1183 1183 * the zone's share percent.
1184 1184 */
1185 1185 if (pset_shares == 0)
1186 1186 zone_shr_pct = 1000;
1187 1187 else
1188 1188 zone_shr_pct =
1189 1189 (zone_ext_shares * 1000) /
1190 1190 pset_shares;
1191 1191
1192 1192 fssproj->fssp_shr_pct = zone_shr_pct / 2;
1193 1193
1194 1194 fssproj->fssp_shusage = (fssproj->fssp_usage *
1195 1195 zone_int_shares * zone_int_shares) /
1196 1196 (zone_ext_shares * zone_ext_shares);
1197 1197 } else {
1198 1198 /*
1199 1199 * Thread's priority is based on its project's
1200 1200 * normalized usage (shusage) value which gets
1201 1201 * calculated this way:
1202 1202 *
1203 1203 * pset_shares^2 zone_int_shares^2
1204 1204 * usage * ------------- * ------------------
|
↓ open down ↓ |
1170 lines elided |
↑ open up ↑ |
1205 1205 * kpj_shares^2 zone_ext_shares^2
1206 1206 *
1207 1207 * Where zone_int_shares is the sum of shares
1208 1208 * of all active projects within the zone (and
1209 1209 * the pset), and zone_ext_shares is the number
1210 1210 * of zone shares (ie, zone.cpu-shares).
1211 1211 *
1212 1212 * If there is only one zone active on the pset
1213 1213 * the above reduces to:
1214 1214 *
1215 - * zone_int_shares^2
1215 + * zone_int_shares^2
1216 1216 * shusage = usage * ---------------------
1217 - * kpj_shares^2
1217 + * kpj_shares^2
1218 1218 *
1219 1219 * If there's only one project active in the
1220 1220 * zone this formula reduces to:
1221 1221 *
1222 1222 * pset_shares^2
1223 1223 * shusage = usage * ----------------------
1224 1224 * zone_ext_shares^2
1225 1225 *
1226 1226 * shusage is one input to calculating fss_pri
1227 1227 * in fss_newpri(). Larger values tend toward
1228 1228 * lower priorities for processes in the proj.
1229 1229 */
1230 1230 fssproj->fssp_shusage = fssproj->fssp_usage *
1231 1231 pset_shares * zone_int_shares;
1232 1232 fssproj->fssp_shusage /=
1233 1233 kpj_shares * zone_ext_shares;
1234 1234 fssproj->fssp_shusage *=
1235 1235 pset_shares * zone_int_shares;
1236 1236 fssproj->fssp_shusage /=
1237 1237 kpj_shares * zone_ext_shares;
1238 1238 }
1239 1239 fssproj = fssproj->fssp_next;
1240 1240 } while (fssproj != fsspset->fssps_list);
1241 1241
1242 1242 disp_lock_exit(&fsspset->fssps_displock);
1243 1243 mutex_exit(&fsspset->fssps_lock);
1244 1244 }
1245 1245 mutex_exit(&fsspsets_lock);
1246 1246 }
1247 1247
1248 1248 static void
1249 1249 fss_change_priority(kthread_t *t, fssproc_t *fssproc)
1250 1250 {
1251 1251 pri_t new_pri;
1252 1252
1253 1253 ASSERT(THREAD_LOCK_HELD(t));
1254 1254 new_pri = fssproc->fss_umdpri;
1255 1255 ASSERT(new_pri >= 0 && new_pri <= fss_maxglobpri);
1256 1256
1257 1257 t->t_cpri = fssproc->fss_upri;
1258 1258 fssproc->fss_flags &= ~FSSRESTORE;
1259 1259 if (t == curthread || t->t_state == TS_ONPROC) {
1260 1260 /*
1261 1261 * curthread is always onproc
1262 1262 */
1263 1263 cpu_t *cp = t->t_disp_queue->disp_cpu;
1264 1264 THREAD_CHANGE_PRI(t, new_pri);
1265 1265 if (t == cp->cpu_dispthread)
1266 1266 cp->cpu_dispatch_pri = DISP_PRIO(t);
1267 1267 if (DISP_MUST_SURRENDER(t)) {
1268 1268 fssproc->fss_flags |= FSSBACKQ;
1269 1269 cpu_surrender(t);
1270 1270 } else {
1271 1271 fssproc->fss_timeleft = fss_quantum;
1272 1272 }
1273 1273 } else {
1274 1274 /*
1275 1275 * When the priority of a thread is changed, it may be
1276 1276 * necessary to adjust its position on a sleep queue or
1277 1277 * dispatch queue. The function thread_change_pri accomplishes
1278 1278 * this.
1279 1279 */
1280 1280 if (thread_change_pri(t, new_pri, 0)) {
1281 1281 /*
1282 1282 * The thread was on a run queue.
1283 1283 */
1284 1284 fssproc->fss_timeleft = fss_quantum;
1285 1285 } else {
1286 1286 fssproc->fss_flags |= FSSBACKQ;
1287 1287 }
1288 1288 }
1289 1289 }
1290 1290
1291 1291 /*
1292 1292 * Update priorities of all fair-sharing threads that are currently runnable
1293 1293 * at a user mode priority based on the number of shares and current usage.
1294 1294 * Called once per second via timeout which we reset here.
1295 1295 *
1296 1296 * There are several lists of fair-sharing threads broken up by a hash on the
1297 1297 * thread pointer. Each list has its own lock. This avoids blocking all
1298 1298 * fss_enterclass, fss_fork, and fss_exitclass operations while fss_update runs.
1299 1299 * fss_update traverses each list in turn.
1300 1300 *
1301 1301 * Each time we're run (once/second) we may start at the next list and iterate
1302 1302 * through all of the lists. By starting with a different list, we mitigate any
1303 1303 * effects we would see updating the fssps_maxfsspri value in fss_newpri.
1304 1304 */
1305 1305 static void
1306 1306 fss_update(void *arg)
1307 1307 {
1308 1308 int i;
1309 1309 int new_marker = -1;
1310 1310 static int fss_update_marker;
1311 1311
1312 1312 /*
1313 1313 * Decay and update usages for all projects.
1314 1314 */
1315 1315 fss_decay_usage();
1316 1316
1317 1317 /*
1318 1318 * Start with the fss_update_marker list, then do the rest.
1319 1319 */
1320 1320 i = fss_update_marker;
1321 1321
1322 1322 /*
1323 1323 * Go around all threads, set new priorities and decay
1324 1324 * per-thread CPU usages.
1325 1325 */
1326 1326 do {
1327 1327 /*
1328 1328 * If this is the first list after the current marker to have
1329 1329 * threads with priority updates, advance the marker to this
1330 1330 * list for the next time fss_update runs.
1331 1331 */
1332 1332 if (fss_update_list(i) &&
1333 1333 new_marker == -1 && i != fss_update_marker)
1334 1334 new_marker = i;
1335 1335 } while ((i = FSS_LIST_NEXT(i)) != fss_update_marker);
1336 1336
1337 1337 /*
1338 1338 * Advance marker for the next fss_update call
1339 1339 */
1340 1340 if (new_marker != -1)
1341 1341 fss_update_marker = new_marker;
1342 1342
1343 1343 (void) timeout(fss_update, arg, hz);
1344 1344 }
1345 1345
1346 1346 /*
1347 1347 * Updates priority for a list of threads. Returns 1 if the priority of one
1348 1348 * of the threads was actually updated, 0 if none were for various reasons
1349 1349 * (thread is no longer in the FSS class, is not runnable, has the preemption
1350 1350 * control no-preempt bit set, etc.)
1351 1351 */
1352 1352 static int
1353 1353 fss_update_list(int i)
1354 1354 {
1355 1355 fssproc_t *fssproc;
1356 1356 fssproj_t *fssproj;
1357 1357 fsspri_t fsspri;
1358 1358 pri_t fss_umdpri;
1359 1359 kthread_t *t;
1360 1360 int updated = 0;
1361 1361
1362 1362 mutex_enter(&fss_listlock[i]);
1363 1363 for (fssproc = fss_listhead[i].fss_next; fssproc != &fss_listhead[i];
1364 1364 fssproc = fssproc->fss_next) {
1365 1365 t = fssproc->fss_tp;
|
↓ open down ↓ |
138 lines elided |
↑ open up ↑ |
1366 1366 /*
1367 1367 * Lock the thread and verify the state.
1368 1368 */
1369 1369 thread_lock(t);
1370 1370 /*
1371 1371 * Skip the thread if it is no longer in the FSS class or
1372 1372 * is running with kernel mode priority.
1373 1373 */
1374 1374 if (t->t_cid != fss_cid)
1375 1375 goto next;
1376 - if ((fssproc->fss_flags & FSSKPRI) != 0)
1377 - goto next;
1378 1376
1379 1377 fssproj = FSSPROC2FSSPROJ(fssproc);
1380 1378 if (fssproj == NULL)
1381 1379 goto next;
1382 1380
1383 1381 if (fssproj->fssp_shares != 0) {
1384 1382 /*
1385 1383 * Decay fsspri value.
1386 1384 */
1387 1385 fsspri = fssproc->fss_fsspri;
1388 1386 fsspri = (fsspri * fss_nice_decay[fssproc->fss_nice]) /
1389 1387 FSS_DECAY_BASE;
1390 1388 fssproc->fss_fsspri = fsspri;
1391 1389 }
1392 1390
1393 1391 if (t->t_schedctl && schedctl_get_nopreempt(t))
1394 1392 goto next;
1395 1393 if (t->t_state != TS_RUN && t->t_state != TS_WAIT) {
1396 1394 /*
1397 1395 * Make next syscall/trap call fss_trapret
1398 1396 */
1399 1397 t->t_trapret = 1;
1400 1398 aston(t);
1401 1399 if (t->t_state == TS_ONPROC)
1402 1400 DTRACE_PROBE1(fss__onproc, fssproc_t *,
1403 1401 fssproc);
1404 1402 goto next;
1405 1403 }
1406 1404 fss_newpri(fssproc, B_FALSE);
1407 1405 updated = 1;
1408 1406
1409 1407 fss_umdpri = fssproc->fss_umdpri;
1410 1408
1411 1409 /*
1412 1410 * Only dequeue the thread if it needs to be moved; otherwise
1413 1411 * it should just round-robin here.
1414 1412 */
1415 1413 if (t->t_pri != fss_umdpri)
1416 1414 fss_change_priority(t, fssproc);
1417 1415 next:
1418 1416 thread_unlock(t);
1419 1417 }
1420 1418 mutex_exit(&fss_listlock[i]);
1421 1419 return (updated);
1422 1420 }
1423 1421
1424 1422 /*ARGSUSED*/
1425 1423 static int
1426 1424 fss_admin(caddr_t uaddr, cred_t *reqpcredp)
1427 1425 {
1428 1426 fssadmin_t fssadmin;
1429 1427
1430 1428 if (copyin(uaddr, &fssadmin, sizeof (fssadmin_t)))
1431 1429 return (EFAULT);
1432 1430
1433 1431 switch (fssadmin.fss_cmd) {
1434 1432 case FSS_SETADMIN:
1435 1433 if (secpolicy_dispadm(reqpcredp) != 0)
1436 1434 return (EPERM);
1437 1435 if (fssadmin.fss_quantum <= 0 || fssadmin.fss_quantum >= hz)
1438 1436 return (EINVAL);
1439 1437 fss_quantum = fssadmin.fss_quantum;
1440 1438 break;
1441 1439 case FSS_GETADMIN:
1442 1440 fssadmin.fss_quantum = fss_quantum;
1443 1441 if (copyout(&fssadmin, uaddr, sizeof (fssadmin_t)))
1444 1442 return (EFAULT);
1445 1443 break;
1446 1444 default:
1447 1445 return (EINVAL);
1448 1446 }
1449 1447 return (0);
1450 1448 }
1451 1449
1452 1450 static int
1453 1451 fss_getclinfo(void *infop)
1454 1452 {
1455 1453 fssinfo_t *fssinfo = (fssinfo_t *)infop;
1456 1454 fssinfo->fss_maxupri = fss_maxupri;
1457 1455 return (0);
1458 1456 }
1459 1457
1460 1458 static int
1461 1459 fss_parmsin(void *parmsp)
1462 1460 {
1463 1461 fssparms_t *fssparmsp = (fssparms_t *)parmsp;
1464 1462
1465 1463 /*
1466 1464 * Check validity of parameters.
1467 1465 */
1468 1466 if ((fssparmsp->fss_uprilim > fss_maxupri ||
1469 1467 fssparmsp->fss_uprilim < -fss_maxupri) &&
1470 1468 fssparmsp->fss_uprilim != FSS_NOCHANGE)
1471 1469 return (EINVAL);
1472 1470
1473 1471 if ((fssparmsp->fss_upri > fss_maxupri ||
1474 1472 fssparmsp->fss_upri < -fss_maxupri) &&
1475 1473 fssparmsp->fss_upri != FSS_NOCHANGE)
1476 1474 return (EINVAL);
1477 1475
1478 1476 return (0);
1479 1477 }
1480 1478
1481 1479 /*ARGSUSED*/
1482 1480 static int
1483 1481 fss_parmsout(void *parmsp, pc_vaparms_t *vaparmsp)
1484 1482 {
1485 1483 return (0);
1486 1484 }
1487 1485
1488 1486 static int
1489 1487 fss_vaparmsin(void *parmsp, pc_vaparms_t *vaparmsp)
1490 1488 {
1491 1489 fssparms_t *fssparmsp = (fssparms_t *)parmsp;
1492 1490 int priflag = 0;
1493 1491 int limflag = 0;
1494 1492 uint_t cnt;
1495 1493 pc_vaparm_t *vpp = &vaparmsp->pc_parms[0];
1496 1494
1497 1495 /*
1498 1496 * FSS_NOCHANGE (-32768) is outside of the range of values for
1499 1497 * fss_uprilim and fss_upri. If the structure fssparms_t is changed,
1500 1498 * FSS_NOCHANGE should be replaced by a flag word.
1501 1499 */
1502 1500 fssparmsp->fss_uprilim = FSS_NOCHANGE;
1503 1501 fssparmsp->fss_upri = FSS_NOCHANGE;
1504 1502
1505 1503 /*
1506 1504 * Get the varargs parameter and check validity of parameters.
1507 1505 */
1508 1506 if (vaparmsp->pc_vaparmscnt > PC_VAPARMCNT)
1509 1507 return (EINVAL);
1510 1508
1511 1509 for (cnt = 0; cnt < vaparmsp->pc_vaparmscnt; cnt++, vpp++) {
1512 1510 switch (vpp->pc_key) {
1513 1511 case FSS_KY_UPRILIM:
1514 1512 if (limflag++)
1515 1513 return (EINVAL);
1516 1514 fssparmsp->fss_uprilim = (pri_t)vpp->pc_parm;
1517 1515 if (fssparmsp->fss_uprilim > fss_maxupri ||
1518 1516 fssparmsp->fss_uprilim < -fss_maxupri)
1519 1517 return (EINVAL);
1520 1518 break;
1521 1519 case FSS_KY_UPRI:
1522 1520 if (priflag++)
1523 1521 return (EINVAL);
1524 1522 fssparmsp->fss_upri = (pri_t)vpp->pc_parm;
1525 1523 if (fssparmsp->fss_upri > fss_maxupri ||
1526 1524 fssparmsp->fss_upri < -fss_maxupri)
1527 1525 return (EINVAL);
1528 1526 break;
1529 1527 default:
1530 1528 return (EINVAL);
1531 1529 }
1532 1530 }
1533 1531
1534 1532 if (vaparmsp->pc_vaparmscnt == 0) {
1535 1533 /*
1536 1534 * Use default parameters.
1537 1535 */
1538 1536 fssparmsp->fss_upri = fssparmsp->fss_uprilim = 0;
1539 1537 }
1540 1538
1541 1539 return (0);
1542 1540 }
1543 1541
1544 1542 /*
1545 1543 * Copy all selected fair-sharing class parameters to the user. The parameters
1546 1544 * are specified by a key.
1547 1545 */
1548 1546 static int
1549 1547 fss_vaparmsout(void *parmsp, pc_vaparms_t *vaparmsp)
1550 1548 {
1551 1549 fssparms_t *fssparmsp = (fssparms_t *)parmsp;
1552 1550 int priflag = 0;
1553 1551 int limflag = 0;
1554 1552 uint_t cnt;
1555 1553 pc_vaparm_t *vpp = &vaparmsp->pc_parms[0];
1556 1554
1557 1555 ASSERT(MUTEX_NOT_HELD(&curproc->p_lock));
1558 1556
1559 1557 if (vaparmsp->pc_vaparmscnt > PC_VAPARMCNT)
1560 1558 return (EINVAL);
1561 1559
1562 1560 for (cnt = 0; cnt < vaparmsp->pc_vaparmscnt; cnt++, vpp++) {
1563 1561 switch (vpp->pc_key) {
1564 1562 case FSS_KY_UPRILIM:
1565 1563 if (limflag++)
1566 1564 return (EINVAL);
1567 1565 if (copyout(&fssparmsp->fss_uprilim,
1568 1566 (caddr_t)(uintptr_t)vpp->pc_parm, sizeof (pri_t)))
1569 1567 return (EFAULT);
1570 1568 break;
1571 1569 case FSS_KY_UPRI:
1572 1570 if (priflag++)
1573 1571 return (EINVAL);
1574 1572 if (copyout(&fssparmsp->fss_upri,
1575 1573 (caddr_t)(uintptr_t)vpp->pc_parm, sizeof (pri_t)))
1576 1574 return (EFAULT);
1577 1575 break;
1578 1576 default:
1579 1577 return (EINVAL);
1580 1578 }
1581 1579 }
1582 1580
1583 1581 return (0);
1584 1582 }
1585 1583
1586 1584 /*
1587 1585 * Return the user mode scheduling priority range.
1588 1586 */
1589 1587 static int
1590 1588 fss_getclpri(pcpri_t *pcprip)
1591 1589 {
1592 1590 pcprip->pc_clpmax = fss_maxupri;
1593 1591 pcprip->pc_clpmin = -fss_maxupri;
1594 1592 return (0);
1595 1593 }
1596 1594
1597 1595 static int
1598 1596 fss_alloc(void **p, int flag)
1599 1597 {
1600 1598 void *bufp;
1601 1599
1602 1600 if ((bufp = kmem_zalloc(sizeof (fssproc_t), flag)) == NULL) {
1603 1601 return (ENOMEM);
1604 1602 } else {
1605 1603 *p = bufp;
1606 1604 return (0);
1607 1605 }
1608 1606 }
1609 1607
1610 1608 static void
1611 1609 fss_free(void *bufp)
1612 1610 {
1613 1611 if (bufp)
1614 1612 kmem_free(bufp, sizeof (fssproc_t));
1615 1613 }
1616 1614
1617 1615 /*
1618 1616 * Thread functions
1619 1617 */
1620 1618 static int
1621 1619 fss_enterclass(kthread_t *t, id_t cid, void *parmsp, cred_t *reqpcredp,
1622 1620 void *bufp)
1623 1621 {
1624 1622 fssparms_t *fssparmsp = (fssparms_t *)parmsp;
1625 1623 fssproc_t *fssproc;
1626 1624 pri_t reqfssuprilim;
1627 1625 pri_t reqfssupri;
1628 1626 static uint32_t fssexists = 0;
1629 1627 fsspset_t *fsspset;
1630 1628 fssproj_t *fssproj;
1631 1629 fsszone_t *fsszone;
1632 1630 kproject_t *kpj;
1633 1631 zone_t *zone;
1634 1632 int fsszone_allocated = 0;
1635 1633
1636 1634 fssproc = (fssproc_t *)bufp;
1637 1635 ASSERT(fssproc != NULL);
1638 1636
1639 1637 ASSERT(MUTEX_HELD(&ttoproc(t)->p_lock));
1640 1638
1641 1639 /*
1642 1640 * Only root can move threads to FSS class.
1643 1641 */
1644 1642 if (reqpcredp != NULL && secpolicy_setpriority(reqpcredp) != 0)
1645 1643 return (EPERM);
1646 1644 /*
1647 1645 * Initialize the fssproc structure.
1648 1646 */
1649 1647 fssproc->fss_umdpri = fss_maxumdpri / 2;
1650 1648
1651 1649 if (fssparmsp == NULL) {
1652 1650 /*
1653 1651 * Use default values.
1654 1652 */
1655 1653 fssproc->fss_nice = NZERO;
1656 1654 fssproc->fss_uprilim = fssproc->fss_upri = 0;
1657 1655 } else {
1658 1656 /*
1659 1657 * Use supplied values.
1660 1658 */
1661 1659 if (fssparmsp->fss_uprilim == FSS_NOCHANGE) {
1662 1660 reqfssuprilim = 0;
1663 1661 } else {
1664 1662 if (fssparmsp->fss_uprilim > 0 &&
1665 1663 secpolicy_setpriority(reqpcredp) != 0)
1666 1664 return (EPERM);
1667 1665 reqfssuprilim = fssparmsp->fss_uprilim;
1668 1666 }
1669 1667 if (fssparmsp->fss_upri == FSS_NOCHANGE) {
1670 1668 reqfssupri = reqfssuprilim;
1671 1669 } else {
1672 1670 if (fssparmsp->fss_upri > 0 &&
1673 1671 secpolicy_setpriority(reqpcredp) != 0)
1674 1672 return (EPERM);
1675 1673 /*
1676 1674 * Set the user priority to the requested value or
1677 1675 * the upri limit, whichever is lower.
1678 1676 */
1679 1677 reqfssupri = fssparmsp->fss_upri;
1680 1678 if (reqfssupri > reqfssuprilim)
1681 1679 reqfssupri = reqfssuprilim;
1682 1680 }
1683 1681 fssproc->fss_uprilim = reqfssuprilim;
1684 1682 fssproc->fss_upri = reqfssupri;
1685 1683 fssproc->fss_nice = NZERO - (NZERO * reqfssupri) / fss_maxupri;
1686 1684 if (fssproc->fss_nice > FSS_NICE_MAX)
1687 1685 fssproc->fss_nice = FSS_NICE_MAX;
1688 1686 }
1689 1687
1690 1688 fssproc->fss_timeleft = fss_quantum;
1691 1689 fssproc->fss_tp = t;
1692 1690 cpucaps_sc_init(&fssproc->fss_caps);
1693 1691
1694 1692 /*
1695 1693 * Put a lock on our fsspset structure.
1696 1694 */
1697 1695 mutex_enter(&fsspsets_lock);
1698 1696 fsspset = fss_find_fsspset(t->t_cpupart);
1699 1697 mutex_enter(&fsspset->fssps_lock);
1700 1698 mutex_exit(&fsspsets_lock);
1701 1699
1702 1700 zone = ttoproc(t)->p_zone;
1703 1701 if ((fsszone = fss_find_fsszone(fsspset, zone)) == NULL) {
1704 1702 if ((fsszone = kmem_zalloc(sizeof (fsszone_t), KM_NOSLEEP))
1705 1703 == NULL) {
1706 1704 mutex_exit(&fsspset->fssps_lock);
1707 1705 return (ENOMEM);
1708 1706 } else {
1709 1707 fsszone_allocated = 1;
1710 1708 fss_insert_fsszone(fsspset, zone, fsszone);
1711 1709 }
1712 1710 }
1713 1711 kpj = ttoproj(t);
1714 1712 if ((fssproj = fss_find_fssproj(fsspset, kpj)) == NULL) {
1715 1713 if ((fssproj = kmem_zalloc(sizeof (fssproj_t), KM_NOSLEEP))
1716 1714 == NULL) {
1717 1715 if (fsszone_allocated) {
1718 1716 fss_remove_fsszone(fsspset, fsszone);
1719 1717 kmem_free(fsszone, sizeof (fsszone_t));
1720 1718 }
1721 1719 mutex_exit(&fsspset->fssps_lock);
1722 1720 return (ENOMEM);
1723 1721 } else {
1724 1722 fss_insert_fssproj(fsspset, kpj, fsszone, fssproj);
1725 1723 }
1726 1724 }
1727 1725 fssproj->fssp_threads++;
1728 1726 fssproc->fss_proj = fssproj;
1729 1727
1730 1728 /*
1731 1729 * Reset priority. Process goes to a "user mode" priority here
1732 1730 * regardless of whether or not it has slept since entering the kernel.
1733 1731 */
1734 1732 thread_lock(t);
1735 1733 t->t_clfuncs = &(sclass[cid].cl_funcs->thread);
1736 1734 t->t_cid = cid;
1737 1735 t->t_cldata = (void *)fssproc;
1738 1736 t->t_schedflag |= TS_RUNQMATCH;
1739 1737 fss_change_priority(t, fssproc);
1740 1738 if (t->t_state == TS_RUN || t->t_state == TS_ONPROC ||
1741 1739 t->t_state == TS_WAIT)
1742 1740 fss_active(t);
1743 1741 thread_unlock(t);
1744 1742
1745 1743 mutex_exit(&fsspset->fssps_lock);
1746 1744
1747 1745 /*
1748 1746 * Link new structure into fssproc list.
1749 1747 */
1750 1748 FSS_LIST_INSERT(fssproc);
1751 1749
1752 1750 /*
1753 1751 * If this is the first fair-sharing thread to occur since boot,
1754 1752 * we set up the initial call to fss_update() here. Use an atomic
1755 1753 * compare-and-swap since that's easier and faster than a mutex
1756 1754 * (but check with an ordinary load first since most of the time
1757 1755 * this will already be done).
1758 1756 */
1759 1757 if (fssexists == 0 && atomic_cas_32(&fssexists, 0, 1) == 0)
1760 1758 (void) timeout(fss_update, NULL, hz);
1761 1759
1762 1760 return (0);
1763 1761 }
1764 1762
1765 1763 /*
1766 1764 * Remove fssproc_t from the list.
1767 1765 */
1768 1766 static void
1769 1767 fss_exitclass(void *procp)
1770 1768 {
1771 1769 fssproc_t *fssproc = (fssproc_t *)procp;
1772 1770 fssproj_t *fssproj;
1773 1771 fsspset_t *fsspset;
1774 1772 fsszone_t *fsszone;
1775 1773 kthread_t *t = fssproc->fss_tp;
1776 1774
1777 1775 /*
1778 1776 * We should be either getting this thread off the deathrow or
1779 1777 * this thread has already moved to another scheduling class and
1780 1778 * we're being called with its old cldata buffer pointer. In both
1781 1779 * cases, the content of this buffer can not be changed while we're
1782 1780 * here.
1783 1781 */
1784 1782 mutex_enter(&fsspsets_lock);
1785 1783 thread_lock(t);
1786 1784 if (t->t_cid != fss_cid) {
1787 1785 /*
1788 1786 * We're being called as a result of the priocntl() system
1789 1787 * call -- someone is trying to move our thread to another
1790 1788 * scheduling class. We can't call fss_inactive() here
1791 1789 * because our thread's t_cldata pointer already points
1792 1790 * to another scheduling class specific data.
1793 1791 */
1794 1792 ASSERT(MUTEX_HELD(&ttoproc(t)->p_lock));
1795 1793
1796 1794 fssproj = FSSPROC2FSSPROJ(fssproc);
1797 1795 fsspset = FSSPROJ2FSSPSET(fssproj);
1798 1796 fsszone = fssproj->fssp_fsszone;
1799 1797
1800 1798 if (fssproc->fss_runnable) {
1801 1799 disp_lock_enter_high(&fsspset->fssps_displock);
1802 1800 if (--fssproj->fssp_runnable == 0) {
1803 1801 fsszone->fssz_shares -= fssproj->fssp_shares;
1804 1802 if (--fsszone->fssz_runnable == 0)
1805 1803 fsspset->fssps_shares -=
1806 1804 fsszone->fssz_rshares;
1807 1805 }
1808 1806 disp_lock_exit_high(&fsspset->fssps_displock);
1809 1807 }
1810 1808 thread_unlock(t);
1811 1809
1812 1810 mutex_enter(&fsspset->fssps_lock);
1813 1811 if (--fssproj->fssp_threads == 0) {
1814 1812 fss_remove_fssproj(fsspset, fssproj);
1815 1813 if (fsszone->fssz_nproj == 0)
1816 1814 kmem_free(fsszone, sizeof (fsszone_t));
1817 1815 kmem_free(fssproj, sizeof (fssproj_t));
1818 1816 }
1819 1817 mutex_exit(&fsspset->fssps_lock);
1820 1818
1821 1819 } else {
1822 1820 ASSERT(t->t_state == TS_FREE);
1823 1821 /*
1824 1822 * We're being called from thread_free() when our thread
1825 1823 * is removed from the deathrow. There is nothing we need
1826 1824 * do here since everything should've been done earlier
1827 1825 * in fss_exit().
1828 1826 */
1829 1827 thread_unlock(t);
1830 1828 }
1831 1829 mutex_exit(&fsspsets_lock);
1832 1830
1833 1831 FSS_LIST_DELETE(fssproc);
1834 1832 fss_free(fssproc);
1835 1833 }
1836 1834
1837 1835 /*ARGSUSED*/
1838 1836 static int
1839 1837 fss_canexit(kthread_t *t, cred_t *credp)
1840 1838 {
1841 1839 /*
1842 1840 * A thread is allowed to exit FSS only if we have sufficient
1843 1841 * privileges.
1844 1842 */
1845 1843 if (credp != NULL && secpolicy_setpriority(credp) != 0)
1846 1844 return (EPERM);
1847 1845 else
1848 1846 return (0);
1849 1847 }
1850 1848
1851 1849 /*
1852 1850 * Initialize fair-share class specific proc structure for a child.
1853 1851 */
1854 1852 static int
1855 1853 fss_fork(kthread_t *pt, kthread_t *ct, void *bufp)
1856 1854 {
1857 1855 fssproc_t *pfssproc; /* ptr to parent's fssproc structure */
1858 1856 fssproc_t *cfssproc; /* ptr to child's fssproc structure */
1859 1857 fssproj_t *fssproj;
1860 1858 fsspset_t *fsspset;
1861 1859
1862 1860 ASSERT(MUTEX_HELD(&ttoproc(pt)->p_lock));
1863 1861 ASSERT(ct->t_state == TS_STOPPED);
1864 1862
1865 1863 cfssproc = (fssproc_t *)bufp;
1866 1864 ASSERT(cfssproc != NULL);
1867 1865 bzero(cfssproc, sizeof (fssproc_t));
1868 1866
1869 1867 thread_lock(pt);
1870 1868 pfssproc = FSSPROC(pt);
1871 1869 fssproj = FSSPROC2FSSPROJ(pfssproc);
1872 1870 fsspset = FSSPROJ2FSSPSET(fssproj);
1873 1871 thread_unlock(pt);
1874 1872
1875 1873 mutex_enter(&fsspset->fssps_lock);
1876 1874 /*
1877 1875 * Initialize child's fssproc structure.
1878 1876 */
1879 1877 thread_lock(pt);
1880 1878 ASSERT(FSSPROJ(pt) == fssproj);
1881 1879 cfssproc->fss_proj = fssproj;
|
↓ open down ↓ |
494 lines elided |
↑ open up ↑ |
1882 1880 cfssproc->fss_timeleft = fss_quantum;
1883 1881 cfssproc->fss_umdpri = pfssproc->fss_umdpri;
1884 1882 cfssproc->fss_fsspri = 0;
1885 1883 cfssproc->fss_uprilim = pfssproc->fss_uprilim;
1886 1884 cfssproc->fss_upri = pfssproc->fss_upri;
1887 1885 cfssproc->fss_tp = ct;
1888 1886 cfssproc->fss_nice = pfssproc->fss_nice;
1889 1887 cpucaps_sc_init(&cfssproc->fss_caps);
1890 1888
1891 1889 cfssproc->fss_flags =
1892 - pfssproc->fss_flags & ~(FSSKPRI | FSSBACKQ | FSSRESTORE);
1890 + pfssproc->fss_flags & ~(FSSBACKQ | FSSRESTORE);
1893 1891 ct->t_cldata = (void *)cfssproc;
1894 1892 ct->t_schedflag |= TS_RUNQMATCH;
1895 1893 thread_unlock(pt);
1896 1894
1897 1895 fssproj->fssp_threads++;
1898 1896 mutex_exit(&fsspset->fssps_lock);
1899 1897
1900 1898 /*
1901 1899 * Link new structure into fssproc hash table.
1902 1900 */
1903 1901 FSS_LIST_INSERT(cfssproc);
1904 1902 return (0);
1905 1903 }
1906 1904
1907 1905 /*
1908 1906 * Child is placed at back of dispatcher queue and parent gives up processor
1909 1907 * so that the child runs first after the fork. This allows the child
1910 1908 * immediately execing to break the multiple use of copy on write pages with no
1911 1909 * disk home. The parent will get to steal them back rather than uselessly
1912 1910 * copying them.
1913 1911 */
1914 1912 static void
1915 1913 fss_forkret(kthread_t *t, kthread_t *ct)
1916 1914 {
1917 1915 proc_t *pp = ttoproc(t);
1918 1916 proc_t *cp = ttoproc(ct);
1919 1917 fssproc_t *fssproc;
1920 1918
1921 1919 ASSERT(t == curthread);
1922 1920 ASSERT(MUTEX_HELD(&pidlock));
1923 1921
1924 1922 /*
1925 1923 * Grab the child's p_lock before dropping pidlock to ensure the
1926 1924 * process does not disappear before we set it running.
1927 1925 */
1928 1926 mutex_enter(&cp->p_lock);
1929 1927 continuelwps(cp);
1930 1928 mutex_exit(&cp->p_lock);
1931 1929
1932 1930 mutex_enter(&pp->p_lock);
|
↓ open down ↓ |
30 lines elided |
↑ open up ↑ |
1933 1931 mutex_exit(&pidlock);
1934 1932 continuelwps(pp);
1935 1933
1936 1934 thread_lock(t);
1937 1935
1938 1936 fssproc = FSSPROC(t);
1939 1937 fss_newpri(fssproc, B_FALSE);
1940 1938 fssproc->fss_timeleft = fss_quantum;
1941 1939 t->t_pri = fssproc->fss_umdpri;
1942 1940 ASSERT(t->t_pri >= 0 && t->t_pri <= fss_maxglobpri);
1943 - fssproc->fss_flags &= ~FSSKPRI;
1944 1941 THREAD_TRANSITION(t);
1945 1942
1946 1943 /*
1947 1944 * We don't want to call fss_setrun(t) here because it may call
1948 1945 * fss_active, which we don't need.
1949 1946 */
1950 1947 fssproc->fss_flags &= ~FSSBACKQ;
1951 1948
1952 1949 if (t->t_disp_time != ddi_get_lbolt())
1953 1950 setbackdq(t);
1954 1951 else
1955 1952 setfrontdq(t);
1956 1953
1957 1954 thread_unlock(t);
1958 1955 /*
1959 1956 * Safe to drop p_lock now since it is safe to change
1960 1957 * the scheduling class after this point.
1961 1958 */
1962 1959 mutex_exit(&pp->p_lock);
1963 1960
1964 1961 swtch();
1965 1962 }
1966 1963
1967 1964 /*
1968 1965 * Get the fair-sharing parameters of the thread pointed to by fssprocp into
1969 1966 * the buffer pointed by fssparmsp.
1970 1967 */
1971 1968 static void
1972 1969 fss_parmsget(kthread_t *t, void *parmsp)
1973 1970 {
1974 1971 fssproc_t *fssproc = FSSPROC(t);
1975 1972 fssparms_t *fssparmsp = (fssparms_t *)parmsp;
1976 1973
1977 1974 fssparmsp->fss_uprilim = fssproc->fss_uprilim;
1978 1975 fssparmsp->fss_upri = fssproc->fss_upri;
1979 1976 }
1980 1977
1981 1978 /*ARGSUSED*/
1982 1979 static int
1983 1980 fss_parmsset(kthread_t *t, void *parmsp, id_t reqpcid, cred_t *reqpcredp)
1984 1981 {
1985 1982 char nice;
1986 1983 pri_t reqfssuprilim;
1987 1984 pri_t reqfssupri;
1988 1985 fssproc_t *fssproc = FSSPROC(t);
1989 1986 fssparms_t *fssparmsp = (fssparms_t *)parmsp;
1990 1987
1991 1988 ASSERT(MUTEX_HELD(&(ttoproc(t))->p_lock));
1992 1989
1993 1990 if (fssparmsp->fss_uprilim == FSS_NOCHANGE)
1994 1991 reqfssuprilim = fssproc->fss_uprilim;
1995 1992 else
1996 1993 reqfssuprilim = fssparmsp->fss_uprilim;
1997 1994
1998 1995 if (fssparmsp->fss_upri == FSS_NOCHANGE)
1999 1996 reqfssupri = fssproc->fss_upri;
2000 1997 else
2001 1998 reqfssupri = fssparmsp->fss_upri;
2002 1999
2003 2000 /*
2004 2001 * Make sure the user priority doesn't exceed the upri limit.
2005 2002 */
2006 2003 if (reqfssupri > reqfssuprilim)
2007 2004 reqfssupri = reqfssuprilim;
2008 2005
2009 2006 /*
2010 2007 * Basic permissions enforced by generic kernel code for all classes
2011 2008 * require that a thread attempting to change the scheduling parameters
2012 2009 * of a target thread be privileged or have a real or effective UID
2013 2010 * matching that of the target thread. We are not called unless these
2014 2011 * basic permission checks have already passed. The fair-sharing class
2015 2012 * requires in addition that the calling thread be privileged if it
2016 2013 * is attempting to raise the upri limit above its current value.
2017 2014 * This may have been checked previously but if our caller passed us
2018 2015 * a non-NULL credential pointer we assume it hasn't and we check it
2019 2016 * here.
2020 2017 */
2021 2018 if ((reqpcredp != NULL) &&
2022 2019 (reqfssuprilim > fssproc->fss_uprilim) &&
2023 2020 secpolicy_raisepriority(reqpcredp) != 0)
2024 2021 return (EPERM);
2025 2022
2026 2023 /*
2027 2024 * Set fss_nice to the nice value corresponding to the user priority we
2028 2025 * are setting. Note that setting the nice field of the parameter
2029 2026 * struct won't affect upri or nice.
2030 2027 */
2031 2028 nice = NZERO - (reqfssupri * NZERO) / fss_maxupri;
|
↓ open down ↓ |
78 lines elided |
↑ open up ↑ |
2032 2029 if (nice > FSS_NICE_MAX)
2033 2030 nice = FSS_NICE_MAX;
2034 2031
2035 2032 thread_lock(t);
2036 2033
2037 2034 fssproc->fss_uprilim = reqfssuprilim;
2038 2035 fssproc->fss_upri = reqfssupri;
2039 2036 fssproc->fss_nice = nice;
2040 2037 fss_newpri(fssproc, B_FALSE);
2041 2038
2042 - if ((fssproc->fss_flags & FSSKPRI) != 0) {
2043 - thread_unlock(t);
2044 - return (0);
2045 - }
2046 -
2047 2039 fss_change_priority(t, fssproc);
2048 2040 thread_unlock(t);
2049 2041 return (0);
2050 2042
2051 2043 }
2052 2044
2053 2045 /*
2054 2046 * The thread is being stopped.
2055 2047 */
2056 2048 /*ARGSUSED*/
2057 2049 static void
2058 2050 fss_stop(kthread_t *t, int why, int what)
2059 2051 {
2060 2052 ASSERT(THREAD_LOCK_HELD(t));
2061 2053 ASSERT(t == curthread);
2062 2054
2063 2055 fss_inactive(t);
2064 2056 }
2065 2057
2066 2058 /*
2067 2059 * The current thread is exiting, do necessary adjustments to its project
2068 2060 */
2069 2061 static void
2070 2062 fss_exit(kthread_t *t)
2071 2063 {
2072 2064 fsspset_t *fsspset;
2073 2065 fssproj_t *fssproj;
2074 2066 fssproc_t *fssproc;
2075 2067 fsszone_t *fsszone;
2076 2068 int free = 0;
2077 2069
2078 2070 /*
2079 2071 * Thread t here is either a current thread (in which case we hold
2080 2072 * its process' p_lock), or a thread being destroyed by forklwp_fail(),
2081 2073 * in which case we hold pidlock and thread is no longer on the
2082 2074 * thread list.
2083 2075 */
2084 2076 ASSERT(MUTEX_HELD(&(ttoproc(t))->p_lock) || MUTEX_HELD(&pidlock));
2085 2077
2086 2078 fssproc = FSSPROC(t);
2087 2079 fssproj = FSSPROC2FSSPROJ(fssproc);
2088 2080 fsspset = FSSPROJ2FSSPSET(fssproj);
2089 2081 fsszone = fssproj->fssp_fsszone;
2090 2082
2091 2083 mutex_enter(&fsspsets_lock);
2092 2084 mutex_enter(&fsspset->fssps_lock);
2093 2085
2094 2086 thread_lock(t);
2095 2087 disp_lock_enter_high(&fsspset->fssps_displock);
2096 2088 if (t->t_state == TS_ONPROC || t->t_state == TS_RUN) {
2097 2089 if (--fssproj->fssp_runnable == 0) {
2098 2090 fsszone->fssz_shares -= fssproj->fssp_shares;
2099 2091 if (--fsszone->fssz_runnable == 0)
2100 2092 fsspset->fssps_shares -= fsszone->fssz_rshares;
2101 2093 }
2102 2094 ASSERT(fssproc->fss_runnable == 1);
2103 2095 fssproc->fss_runnable = 0;
2104 2096 }
2105 2097 if (--fssproj->fssp_threads == 0) {
2106 2098 fss_remove_fssproj(fsspset, fssproj);
2107 2099 free = 1;
2108 2100 }
2109 2101 disp_lock_exit_high(&fsspset->fssps_displock);
2110 2102 fssproc->fss_proj = NULL; /* mark this thread as already exited */
2111 2103 thread_unlock(t);
2112 2104
2113 2105 if (free) {
2114 2106 if (fsszone->fssz_nproj == 0)
2115 2107 kmem_free(fsszone, sizeof (fsszone_t));
2116 2108 kmem_free(fssproj, sizeof (fssproj_t));
2117 2109 }
2118 2110 mutex_exit(&fsspset->fssps_lock);
2119 2111 mutex_exit(&fsspsets_lock);
2120 2112
2121 2113 /*
2122 2114 * A thread could be exiting in between clock ticks, so we need to
2123 2115 * calculate how much CPU time it used since it was charged last time.
2124 2116 *
2125 2117 * CPU caps are not enforced on exiting processes - it is usually
2126 2118 * desirable to exit as soon as possible to free resources.
2127 2119 */
2128 2120 if (CPUCAPS_ON()) {
2129 2121 thread_lock(t);
2130 2122 fssproc = FSSPROC(t);
2131 2123 (void) cpucaps_charge(t, &fssproc->fss_caps,
2132 2124 CPUCAPS_CHARGE_ONLY);
2133 2125 thread_unlock(t);
2134 2126 }
2135 2127 }
2136 2128
2137 2129 static void
2138 2130 fss_nullsys()
2139 2131 {
2140 2132 }
2141 2133
2142 2134 /*
2143 2135 * fss_swapin() returns -1 if the thread is loaded or is not eligible to be
2144 2136 * swapped in. Otherwise, it returns the thread's effective priority based
2145 2137 * on swapout time and size of process (0 <= epri <= 0 SHRT_MAX).
2146 2138 */
2147 2139 /*ARGSUSED*/
2148 2140 static pri_t
2149 2141 fss_swapin(kthread_t *t, int flags)
2150 2142 {
|
↓ open down ↓ |
94 lines elided |
↑ open up ↑ |
2151 2143 fssproc_t *fssproc = FSSPROC(t);
2152 2144 long epri = -1;
2153 2145 proc_t *pp = ttoproc(t);
2154 2146
2155 2147 ASSERT(THREAD_LOCK_HELD(t));
2156 2148
2157 2149 if (t->t_state == TS_RUN && (t->t_schedflag & TS_LOAD) == 0) {
2158 2150 time_t swapout_time;
2159 2151
2160 2152 swapout_time = (ddi_get_lbolt() - t->t_stime) / hz;
2161 - if (INHERITED(t) || (fssproc->fss_flags & FSSKPRI)) {
2153 + if (INHERITED(t)) {
2162 2154 epri = (long)DISP_PRIO(t) + swapout_time;
2163 2155 } else {
2164 2156 /*
2165 2157 * Threads which have been out for a long time,
2166 2158 * have high user mode priority and are associated
2167 2159 * with a small address space are more deserving.
2168 2160 */
2169 2161 epri = fssproc->fss_umdpri;
2170 2162 ASSERT(epri >= 0 && epri <= fss_maxumdpri);
2171 2163 epri += swapout_time - pp->p_swrss / nz(maxpgio)/2;
2172 2164 }
2173 2165 /*
2174 2166 * Scale epri so that SHRT_MAX / 2 represents zero priority.
2175 2167 */
2176 2168 epri += SHRT_MAX / 2;
2177 2169 if (epri < 0)
2178 2170 epri = 0;
2179 2171 else if (epri > SHRT_MAX)
2180 2172 epri = SHRT_MAX;
2181 2173 }
2182 2174 return ((pri_t)epri);
|
↓ open down ↓ |
11 lines elided |
↑ open up ↑ |
2183 2175 }
2184 2176
2185 2177 /*
2186 2178 * fss_swapout() returns -1 if the thread isn't loaded or is not eligible to
2187 2179 * be swapped out. Otherwise, it returns the thread's effective priority
2188 2180 * based on if the swapper is in softswap or hardswap mode.
2189 2181 */
2190 2182 static pri_t
2191 2183 fss_swapout(kthread_t *t, int flags)
2192 2184 {
2193 - fssproc_t *fssproc = FSSPROC(t);
2194 2185 long epri = -1;
2195 2186 proc_t *pp = ttoproc(t);
2196 2187 time_t swapin_time;
2197 2188
2198 2189 ASSERT(THREAD_LOCK_HELD(t));
2199 2190
2200 2191 if (INHERITED(t) ||
2201 - (fssproc->fss_flags & FSSKPRI) ||
2202 2192 (t->t_proc_flag & TP_LWPEXIT) ||
2203 2193 (t->t_state & (TS_ZOMB|TS_FREE|TS_STOPPED|TS_ONPROC|TS_WAIT)) ||
2204 2194 !(t->t_schedflag & TS_LOAD) ||
2205 2195 !(SWAP_OK(t)))
2206 2196 return (-1);
2207 2197
2208 2198 ASSERT(t->t_state & (TS_SLEEP | TS_RUN));
2209 2199
2210 2200 swapin_time = (ddi_get_lbolt() - t->t_stime) / hz;
2211 2201
2212 2202 if (flags == SOFTSWAP) {
2213 2203 if (t->t_state == TS_SLEEP && swapin_time > maxslp) {
2214 2204 epri = 0;
2215 2205 } else {
2216 2206 return ((pri_t)epri);
2217 2207 }
2218 2208 } else {
2219 2209 pri_t pri;
2220 2210
2221 2211 if ((t->t_state == TS_SLEEP && swapin_time > fss_minslp) ||
2222 2212 (t->t_state == TS_RUN && swapin_time > fss_minrun)) {
2223 2213 pri = fss_maxumdpri;
2224 2214 epri = swapin_time -
2225 2215 (rm_asrss(pp->p_as) / nz(maxpgio)/2) - (long)pri;
2226 2216 } else {
2227 2217 return ((pri_t)epri);
2228 2218 }
2229 2219 }
2230 2220
2231 2221 /*
2232 2222 * Scale epri so that SHRT_MAX / 2 represents zero priority.
2233 2223 */
|
↓ open down ↓ |
22 lines elided |
↑ open up ↑ |
2234 2224 epri += SHRT_MAX / 2;
2235 2225 if (epri < 0)
2236 2226 epri = 0;
2237 2227 else if (epri > SHRT_MAX)
2238 2228 epri = SHRT_MAX;
2239 2229
2240 2230 return ((pri_t)epri);
2241 2231 }
2242 2232
2243 2233 /*
2244 - * If thread is currently at a kernel mode priority (has slept) and is
2245 - * returning to the userland we assign it the appropriate user mode priority
2246 - * and time quantum here. If we're lowering the thread's priority below that
2247 - * of other runnable threads then we will set runrun via cpu_surrender() to
2248 - * cause preemption.
2234 + * Run swap-out checks when returning to userspace.
2249 2235 */
2250 2236 static void
2251 2237 fss_trapret(kthread_t *t)
2252 2238 {
2253 - fssproc_t *fssproc = FSSPROC(t);
2254 2239 cpu_t *cp = CPU;
2255 2240
2256 2241 ASSERT(THREAD_LOCK_HELD(t));
2257 2242 ASSERT(t == curthread);
2258 2243 ASSERT(cp->cpu_dispthread == t);
2259 2244 ASSERT(t->t_state == TS_ONPROC);
2260 2245
2261 - t->t_kpri_req = 0;
2262 - if (fssproc->fss_flags & FSSKPRI) {
2263 - /*
2264 - * If thread has blocked in the kernel
2265 - */
2266 - THREAD_CHANGE_PRI(t, fssproc->fss_umdpri);
2267 - cp->cpu_dispatch_pri = DISP_PRIO(t);
2268 - ASSERT(t->t_pri >= 0 && t->t_pri <= fss_maxglobpri);
2269 - fssproc->fss_flags &= ~FSSKPRI;
2270 -
2271 - if (DISP_MUST_SURRENDER(t))
2272 - cpu_surrender(t);
2273 - }
2274 -
2275 2246 /*
2276 2247 * Swapout lwp if the swapper is waiting for this thread to reach
2277 2248 * a safe point.
2278 2249 */
2279 2250 if (t->t_schedflag & TS_SWAPENQ) {
2280 2251 thread_unlock(t);
2281 2252 swapout_lwp(ttolwp(t));
2282 2253 thread_lock(t);
2283 2254 }
2284 2255 }
2285 2256
2286 2257 /*
2287 2258 * Arrange for thread to be placed in appropriate location on dispatcher queue.
2288 2259 * This is called with the current thread in TS_ONPROC and locked.
2289 2260 */
2290 2261 static void
2291 2262 fss_preempt(kthread_t *t)
|
↓ open down ↓ |
7 lines elided |
↑ open up ↑ |
2292 2263 {
2293 2264 fssproc_t *fssproc = FSSPROC(t);
2294 2265 klwp_t *lwp;
2295 2266 uint_t flags;
2296 2267
2297 2268 ASSERT(t == curthread);
2298 2269 ASSERT(THREAD_LOCK_HELD(curthread));
2299 2270 ASSERT(t->t_state == TS_ONPROC);
2300 2271
2301 2272 /*
2302 - * If preempted in the kernel, make sure the thread has a kernel
2303 - * priority if needed.
2304 - */
2305 - lwp = curthread->t_lwp;
2306 - if (!(fssproc->fss_flags & FSSKPRI) && lwp != NULL && t->t_kpri_req) {
2307 - fssproc->fss_flags |= FSSKPRI;
2308 - THREAD_CHANGE_PRI(t, minclsyspri);
2309 - ASSERT(t->t_pri >= 0 && t->t_pri <= fss_maxglobpri);
2310 - t->t_trapret = 1; /* so that fss_trapret will run */
2311 - aston(t);
2312 - }
2313 -
2314 - /*
2315 2273 * This thread may be placed on wait queue by CPU Caps. In this case we
2316 2274 * do not need to do anything until it is removed from the wait queue.
2317 2275 * Do not enforce CPU caps on threads running at a kernel priority
2318 2276 */
2319 2277 if (CPUCAPS_ON()) {
2320 2278 (void) cpucaps_charge(t, &fssproc->fss_caps,
2321 2279 CPUCAPS_CHARGE_ENFORCE);
2322 2280
2323 - if (!(fssproc->fss_flags & FSSKPRI) && CPUCAPS_ENFORCE(t))
2281 + if (CPUCAPS_ENFORCE(t))
2324 2282 return;
2325 2283 }
2326 2284
2327 2285 /*
2328 2286 * If preempted in user-land mark the thread as swappable because it
2329 2287 * cannot be holding any kernel locks.
2330 2288 */
2331 2289 ASSERT(t->t_schedflag & TS_DONT_SWAP);
2290 + lwp = ttolwp(t);
2332 2291 if (lwp != NULL && lwp->lwp_state == LWP_USER)
2333 2292 t->t_schedflag &= ~TS_DONT_SWAP;
2334 2293
2335 2294 /*
2336 2295 * Check to see if we're doing "preemption control" here. If
2337 2296 * we are, and if the user has requested that this thread not
2338 2297 * be preempted, and if preemptions haven't been put off for
2339 2298 * too long, let the preemption happen here but try to make
2340 2299 * sure the thread is rescheduled as soon as possible. We do
2341 2300 * this by putting it on the front of the highest priority run
2342 2301 * queue in the FSS class. If the preemption has been put off
2343 2302 * for too long, clear the "nopreempt" bit and let the thread
2344 2303 * be preempted.
2345 2304 */
2346 2305 if (t->t_schedctl && schedctl_get_nopreempt(t)) {
2347 2306 if (fssproc->fss_timeleft > -SC_MAX_TICKS) {
2348 2307 DTRACE_SCHED1(schedctl__nopreempt, kthread_t *, t);
2349 - if (!(fssproc->fss_flags & FSSKPRI)) {
2350 - /*
2351 - * If not already remembered, remember current
2352 - * priority for restoration in fss_yield().
2353 - */
2354 - if (!(fssproc->fss_flags & FSSRESTORE)) {
2355 - fssproc->fss_scpri = t->t_pri;
2356 - fssproc->fss_flags |= FSSRESTORE;
2357 - }
2358 - THREAD_CHANGE_PRI(t, fss_maxumdpri);
2359 - t->t_schedflag |= TS_DONT_SWAP;
2308 + /*
2309 + * If not already remembered, remember current
2310 + * priority for restoration in fss_yield().
2311 + */
2312 + if (!(fssproc->fss_flags & FSSRESTORE)) {
2313 + fssproc->fss_scpri = t->t_pri;
2314 + fssproc->fss_flags |= FSSRESTORE;
2360 2315 }
2316 + THREAD_CHANGE_PRI(t, fss_maxumdpri);
2317 + t->t_schedflag |= TS_DONT_SWAP;
2361 2318 schedctl_set_yield(t, 1);
2362 2319 setfrontdq(t);
2363 2320 return;
2364 2321 } else {
2365 2322 if (fssproc->fss_flags & FSSRESTORE) {
2366 2323 THREAD_CHANGE_PRI(t, fssproc->fss_scpri);
2367 2324 fssproc->fss_flags &= ~FSSRESTORE;
2368 2325 }
2369 2326 schedctl_set_nopreempt(t, 0);
2370 2327 DTRACE_SCHED1(schedctl__preempt, kthread_t *, t);
2371 2328 /*
2372 2329 * Fall through and be preempted below.
2373 2330 */
2374 2331 }
2375 2332 }
2376 2333
2377 - flags = fssproc->fss_flags & (FSSBACKQ | FSSKPRI);
2334 + flags = fssproc->fss_flags & FSSBACKQ;
2378 2335
2379 2336 if (flags == FSSBACKQ) {
2380 2337 fssproc->fss_timeleft = fss_quantum;
2381 2338 fssproc->fss_flags &= ~FSSBACKQ;
2382 2339 setbackdq(t);
2383 - } else if (flags == (FSSBACKQ | FSSKPRI)) {
2384 - fssproc->fss_flags &= ~FSSBACKQ;
2385 - setbackdq(t);
2386 2340 } else {
2387 2341 setfrontdq(t);
2388 2342 }
2389 2343 }
2390 2344
2391 2345 /*
2392 2346 * Called when a thread is waking up and is to be placed on the run queue.
2393 2347 */
2394 2348 static void
2395 2349 fss_setrun(kthread_t *t)
2396 2350 {
|
↓ open down ↓ |
1 lines elided |
↑ open up ↑ |
2397 2351 fssproc_t *fssproc = FSSPROC(t);
2398 2352
2399 2353 ASSERT(THREAD_LOCK_HELD(t)); /* t should be in transition */
2400 2354
2401 2355 if (t->t_state == TS_SLEEP || t->t_state == TS_STOPPED)
2402 2356 fss_active(t);
2403 2357
2404 2358 fssproc->fss_timeleft = fss_quantum;
2405 2359
2406 2360 fssproc->fss_flags &= ~FSSBACKQ;
2407 - /*
2408 - * If previously were running at the kernel priority then keep that
2409 - * priority and the fss_timeleft doesn't matter.
2410 - */
2411 - if ((fssproc->fss_flags & FSSKPRI) == 0)
2412 - THREAD_CHANGE_PRI(t, fssproc->fss_umdpri);
2361 + THREAD_CHANGE_PRI(t, fssproc->fss_umdpri);
2413 2362
2414 2363 if (t->t_disp_time != ddi_get_lbolt())
2415 2364 setbackdq(t);
2416 2365 else
2417 2366 setfrontdq(t);
2418 2367 }
2419 2368
2420 2369 /*
2421 - * Prepare thread for sleep. We reset the thread priority so it will run at the
2422 - * kernel priority level when it wakes up.
2370 + * Prepare thread for sleep.
2423 2371 */
2424 2372 static void
2425 2373 fss_sleep(kthread_t *t)
2426 2374 {
2427 2375 fssproc_t *fssproc = FSSPROC(t);
2428 2376
2429 2377 ASSERT(t == curthread);
2430 2378 ASSERT(THREAD_LOCK_HELD(t));
2431 2379
2432 2380 ASSERT(t->t_state == TS_ONPROC);
2433 2381
2434 2382 /*
2435 2383 * Account for time spent on CPU before going to sleep.
2436 2384 */
2437 2385 (void) CPUCAPS_CHARGE(t, &fssproc->fss_caps, CPUCAPS_CHARGE_ENFORCE);
2438 2386
2439 2387 fss_inactive(t);
2440 -
2441 - /*
2442 - * Assign a system priority to the thread and arrange for it to be
2443 - * retained when the thread is next placed on the run queue (i.e.,
2444 - * when it wakes up) instead of being given a new pri. Also arrange
2445 - * for trapret processing as the thread leaves the system call so it
2446 - * will drop back to normal priority range.
2447 - */
2448 - if (t->t_kpri_req) {
2449 - THREAD_CHANGE_PRI(t, minclsyspri);
2450 - fssproc->fss_flags |= FSSKPRI;
2451 - t->t_trapret = 1; /* so that fss_trapret will run */
2452 - aston(t);
2453 - } else if (fssproc->fss_flags & FSSKPRI) {
2454 - /*
2455 - * The thread has done a THREAD_KPRI_REQUEST(), slept, then
2456 - * done THREAD_KPRI_RELEASE() (so no t_kpri_req is 0 again),
2457 - * then slept again all without finishing the current system
2458 - * call so trapret won't have cleared FSSKPRI
2459 - */
2460 - fssproc->fss_flags &= ~FSSKPRI;
2461 - THREAD_CHANGE_PRI(t, fssproc->fss_umdpri);
2462 - if (DISP_MUST_SURRENDER(curthread))
2463 - cpu_surrender(t);
2464 - }
2465 2388 t->t_stime = ddi_get_lbolt(); /* time stamp for the swapper */
2466 2389 }
2467 2390
2468 2391 /*
2469 2392 * A tick interrupt has ocurrend on a running thread. Check to see if our
2470 2393 * time slice has expired. We must also clear the TS_DONT_SWAP flag in
2471 2394 * t_schedflag if the thread is eligible to be swapped out.
2472 2395 */
2473 2396 static void
2474 2397 fss_tick(kthread_t *t)
2475 2398 {
2476 2399 fssproc_t *fssproc;
2477 2400 fssproj_t *fssproj;
2478 2401 klwp_t *lwp;
2479 2402 boolean_t call_cpu_surrender = B_FALSE;
2480 2403 boolean_t cpucaps_enforce = B_FALSE;
2481 2404
2482 2405 ASSERT(MUTEX_HELD(&(ttoproc(t))->p_lock));
2483 2406
2484 2407 /*
2485 2408 * It's safe to access fsspset and fssproj structures because we're
2486 2409 * holding our p_lock here.
2487 2410 */
2488 2411 thread_lock(t);
2489 2412 fssproc = FSSPROC(t);
2490 2413 fssproj = FSSPROC2FSSPROJ(fssproc);
2491 2414 if (fssproj != NULL) {
2492 2415 fsspset_t *fsspset = FSSPROJ2FSSPSET(fssproj);
2493 2416 disp_lock_enter_high(&fsspset->fssps_displock);
2494 2417 fssproj->fssp_ticks += fss_nice_tick[fssproc->fss_nice];
2495 2418 fssproj->fssp_tick_cnt++;
|
↓ open down ↓ |
21 lines elided |
↑ open up ↑ |
2496 2419 fssproc->fss_ticks++;
2497 2420 disp_lock_exit_high(&fsspset->fssps_displock);
2498 2421 }
2499 2422
2500 2423 /*
2501 2424 * Keep track of thread's project CPU usage. Note that projects
2502 2425 * get charged even when threads are running in the kernel.
2503 2426 * Do not surrender CPU if running in the SYS class.
2504 2427 */
2505 2428 if (CPUCAPS_ON()) {
2506 - cpucaps_enforce = cpucaps_charge(t,
2507 - &fssproc->fss_caps, CPUCAPS_CHARGE_ENFORCE) &&
2508 - !(fssproc->fss_flags & FSSKPRI);
2429 + cpucaps_enforce = cpucaps_charge(t, &fssproc->fss_caps,
2430 + CPUCAPS_CHARGE_ENFORCE);
2509 2431 }
2510 2432
2511 - /*
2512 - * A thread's execution time for threads running in the SYS class
2513 - * is not tracked.
2514 - */
2515 - if ((fssproc->fss_flags & FSSKPRI) == 0) {
2433 + if (--fssproc->fss_timeleft <= 0) {
2434 + pri_t new_pri;
2435 +
2516 2436 /*
2517 - * If thread is not in kernel mode, decrement its fss_timeleft
2437 + * If we're doing preemption control and trying to avoid
2438 + * preempting this thread, just note that the thread should
2439 + * yield soon and let it keep running (unless it's been a
2440 + * while).
2518 2441 */
2519 - if (--fssproc->fss_timeleft <= 0) {
2520 - pri_t new_pri;
2521 -
2522 - /*
2523 - * If we're doing preemption control and trying to
2524 - * avoid preempting this thread, just note that the
2525 - * thread should yield soon and let it keep running
2526 - * (unless it's been a while).
2527 - */
2528 - if (t->t_schedctl && schedctl_get_nopreempt(t)) {
2529 - if (fssproc->fss_timeleft > -SC_MAX_TICKS) {
2530 - DTRACE_SCHED1(schedctl__nopreempt,
2531 - kthread_t *, t);
2532 - schedctl_set_yield(t, 1);
2533 - thread_unlock_nopreempt(t);
2534 - return;
2535 - }
2442 + if (t->t_schedctl && schedctl_get_nopreempt(t)) {
2443 + if (fssproc->fss_timeleft > -SC_MAX_TICKS) {
2444 + DTRACE_SCHED1(schedctl__nopreempt,
2445 + kthread_t *, t);
2446 + schedctl_set_yield(t, 1);
2447 + thread_unlock_nopreempt(t);
2448 + return;
2536 2449 }
2537 - fssproc->fss_flags &= ~FSSRESTORE;
2450 + }
2451 + fssproc->fss_flags &= ~FSSRESTORE;
2538 2452
2539 - fss_newpri(fssproc, B_TRUE);
2540 - new_pri = fssproc->fss_umdpri;
2541 - ASSERT(new_pri >= 0 && new_pri <= fss_maxglobpri);
2453 + fss_newpri(fssproc, B_TRUE);
2454 + new_pri = fssproc->fss_umdpri;
2455 + ASSERT(new_pri >= 0 && new_pri <= fss_maxglobpri);
2542 2456
2543 - /*
2544 - * When the priority of a thread is changed, it may
2545 - * be necessary to adjust its position on a sleep queue
2546 - * or dispatch queue. The function thread_change_pri
2547 - * accomplishes this.
2548 - */
2549 - if (thread_change_pri(t, new_pri, 0)) {
2550 - if ((t->t_schedflag & TS_LOAD) &&
2551 - (lwp = t->t_lwp) &&
2552 - lwp->lwp_state == LWP_USER)
2553 - t->t_schedflag &= ~TS_DONT_SWAP;
2554 - fssproc->fss_timeleft = fss_quantum;
2555 - } else {
2556 - call_cpu_surrender = B_TRUE;
2557 - }
2558 - } else if (t->t_state == TS_ONPROC &&
2559 - t->t_pri < t->t_disp_queue->disp_maxrunpri) {
2560 - /*
2561 - * If there is a higher-priority thread which is
2562 - * waiting for a processor, then thread surrenders
2563 - * the processor.
2564 - */
2457 + /*
2458 + * When the priority of a thread is changed, it may be
2459 + * necessary to adjust its position on a sleep queue or
2460 + * dispatch queue. The function thread_change_pri accomplishes
2461 + * this.
2462 + */
2463 + if (thread_change_pri(t, new_pri, 0)) {
2464 + if ((t->t_schedflag & TS_LOAD) &&
2465 + (lwp = t->t_lwp) &&
2466 + lwp->lwp_state == LWP_USER)
2467 + t->t_schedflag &= ~TS_DONT_SWAP;
2468 + fssproc->fss_timeleft = fss_quantum;
2469 + } else {
2565 2470 call_cpu_surrender = B_TRUE;
2566 2471 }
2472 + } else if (t->t_state == TS_ONPROC &&
2473 + t->t_pri < t->t_disp_queue->disp_maxrunpri) {
2474 + /*
2475 + * If there is a higher-priority thread which is waiting for a
2476 + * processor, then thread surrenders the processor.
2477 + */
2478 + call_cpu_surrender = B_TRUE;
2567 2479 }
2568 2480
2569 2481 if (cpucaps_enforce && 2 * fssproc->fss_timeleft > fss_quantum) {
2570 2482 /*
2571 2483 * The thread used more than half of its quantum, so assume that
2572 2484 * it used the whole quantum.
2573 2485 *
2574 2486 * Update thread's priority just before putting it on the wait
2575 2487 * queue so that it gets charged for the CPU time from its
2576 2488 * quantum even before that quantum expires.
2577 2489 */
2578 2490 fss_newpri(fssproc, B_FALSE);
2579 2491 if (t->t_pri != fssproc->fss_umdpri)
2580 2492 fss_change_priority(t, fssproc);
2581 2493
2582 2494 /*
2583 2495 * We need to call cpu_surrender for this thread due to cpucaps
2584 2496 * enforcement, but fss_change_priority may have already done
2585 2497 * so. In this case FSSBACKQ is set and there is no need to call
2586 2498 * cpu-surrender again.
2587 2499 */
2588 2500 if (!(fssproc->fss_flags & FSSBACKQ))
2589 2501 call_cpu_surrender = B_TRUE;
2590 2502 }
2591 2503
2592 2504 if (call_cpu_surrender) {
2593 2505 fssproc->fss_flags |= FSSBACKQ;
2594 2506 cpu_surrender(t);
2595 2507 }
2596 2508
2597 2509 thread_unlock_nopreempt(t); /* clock thread can't be preempted */
2598 2510 }
2599 2511
2600 2512 /*
2601 2513 * Processes waking up go to the back of their queue. We don't need to assign
2602 2514 * a time quantum here because thread is still at a kernel mode priority and
2603 2515 * the time slicing is not done for threads running in the kernel after
2604 2516 * sleeping. The proper time quantum will be assigned by fss_trapret before the
2605 2517 * thread returns to user mode.
2606 2518 */
2607 2519 static void
2608 2520 fss_wakeup(kthread_t *t)
2609 2521 {
2610 2522 fssproc_t *fssproc;
|
↓ open down ↓ |
34 lines elided |
↑ open up ↑ |
2611 2523
2612 2524 ASSERT(THREAD_LOCK_HELD(t));
2613 2525 ASSERT(t->t_state == TS_SLEEP);
2614 2526
2615 2527 fss_active(t);
2616 2528
2617 2529 t->t_stime = ddi_get_lbolt(); /* time stamp for the swapper */
2618 2530 fssproc = FSSPROC(t);
2619 2531 fssproc->fss_flags &= ~FSSBACKQ;
2620 2532
2621 - if (fssproc->fss_flags & FSSKPRI) {
2622 - /*
2623 - * If we already have a kernel priority assigned, then we
2624 - * just use it.
2625 - */
2626 - setbackdq(t);
2627 - } else if (t->t_kpri_req) {
2628 - /*
2629 - * Give thread a priority boost if we were asked.
2630 - */
2631 - fssproc->fss_flags |= FSSKPRI;
2632 - THREAD_CHANGE_PRI(t, minclsyspri);
2633 - setbackdq(t);
2634 - t->t_trapret = 1; /* so that fss_trapret will run */
2635 - aston(t);
2533 + /* Recalculate the priority. */
2534 + if (t->t_disp_time == ddi_get_lbolt()) {
2535 + setfrontdq(t);
2636 2536 } else {
2637 - /*
2638 - * Otherwise, we recalculate the priority.
2639 - */
2640 - if (t->t_disp_time == ddi_get_lbolt()) {
2641 - setfrontdq(t);
2642 - } else {
2643 - fssproc->fss_timeleft = fss_quantum;
2644 - THREAD_CHANGE_PRI(t, fssproc->fss_umdpri);
2645 - setbackdq(t);
2646 - }
2537 + fssproc->fss_timeleft = fss_quantum;
2538 + THREAD_CHANGE_PRI(t, fssproc->fss_umdpri);
2539 + setbackdq(t);
2647 2540 }
2648 2541 }
2649 2542
2650 2543 /*
2651 2544 * fss_donice() is called when a nice(1) command is issued on the thread to
2652 2545 * alter the priority. The nice(1) command exists in Solaris for compatibility.
2653 2546 * Thread priority adjustments should be done via priocntl(1).
2654 2547 */
2655 2548 static int
2656 2549 fss_donice(kthread_t *t, cred_t *cr, int incr, int *retvalp)
2657 2550 {
2658 2551 int newnice;
2659 2552 fssproc_t *fssproc = FSSPROC(t);
2660 2553 fssparms_t fssparms;
2661 2554
2662 2555 /*
2663 2556 * If there is no change to priority, just return current setting.
2664 2557 */
2665 2558 if (incr == 0) {
2666 2559 if (retvalp)
2667 2560 *retvalp = fssproc->fss_nice - NZERO;
2668 2561 return (0);
2669 2562 }
2670 2563
2671 2564 if ((incr < 0 || incr > 2 * NZERO) && secpolicy_raisepriority(cr) != 0)
2672 2565 return (EPERM);
2673 2566
2674 2567 /*
2675 2568 * Specifying a nice increment greater than the upper limit of
2676 2569 * FSS_NICE_MAX (== 2 * NZERO - 1) will result in the thread's nice
2677 2570 * value being set to the upper limit. We check for this before
2678 2571 * computing the new value because otherwise we could get overflow
2679 2572 * if a privileged user specified some ridiculous increment.
2680 2573 */
2681 2574 if (incr > FSS_NICE_MAX)
2682 2575 incr = FSS_NICE_MAX;
2683 2576
2684 2577 newnice = fssproc->fss_nice + incr;
2685 2578 if (newnice > FSS_NICE_MAX)
2686 2579 newnice = FSS_NICE_MAX;
2687 2580 else if (newnice < FSS_NICE_MIN)
2688 2581 newnice = FSS_NICE_MIN;
2689 2582
2690 2583 fssparms.fss_uprilim = fssparms.fss_upri =
2691 2584 -((newnice - NZERO) * fss_maxupri) / NZERO;
2692 2585
2693 2586 /*
2694 2587 * Reset the uprilim and upri values of the thread.
2695 2588 */
2696 2589 (void) fss_parmsset(t, (void *)&fssparms, (id_t)0, (cred_t *)NULL);
2697 2590
2698 2591 /*
2699 2592 * Although fss_parmsset already reset fss_nice it may not have been
2700 2593 * set to precisely the value calculated above because fss_parmsset
2701 2594 * determines the nice value from the user priority and we may have
2702 2595 * truncated during the integer conversion from nice value to user
2703 2596 * priority and back. We reset fss_nice to the value we calculated
2704 2597 * above.
2705 2598 */
2706 2599 fssproc->fss_nice = (char)newnice;
2707 2600
2708 2601 if (retvalp)
2709 2602 *retvalp = newnice - NZERO;
2710 2603 return (0);
2711 2604 }
2712 2605
2713 2606 /*
2714 2607 * Increment the priority of the specified thread by incr and
2715 2608 * return the new value in *retvalp.
2716 2609 */
2717 2610 static int
2718 2611 fss_doprio(kthread_t *t, cred_t *cr, int incr, int *retvalp)
2719 2612 {
2720 2613 int newpri;
2721 2614 fssproc_t *fssproc = FSSPROC(t);
2722 2615 fssparms_t fssparms;
2723 2616
2724 2617 /*
2725 2618 * If there is no change to priority, just return current setting.
2726 2619 */
2727 2620 if (incr == 0) {
2728 2621 *retvalp = fssproc->fss_upri;
2729 2622 return (0);
2730 2623 }
2731 2624
2732 2625 newpri = fssproc->fss_upri + incr;
2733 2626 if (newpri > fss_maxupri || newpri < -fss_maxupri)
2734 2627 return (EINVAL);
2735 2628
2736 2629 *retvalp = newpri;
2737 2630 fssparms.fss_uprilim = fssparms.fss_upri = newpri;
2738 2631
2739 2632 /*
2740 2633 * Reset the uprilim and upri values of the thread.
2741 2634 */
2742 2635 return (fss_parmsset(t, &fssparms, (id_t)0, cr));
2743 2636 }
2744 2637
2745 2638 /*
2746 2639 * Return the global scheduling priority that would be assigned to a thread
2747 2640 * entering the fair-sharing class with the fss_upri.
2748 2641 */
2749 2642 /*ARGSUSED*/
2750 2643 static pri_t
2751 2644 fss_globpri(kthread_t *t)
2752 2645 {
2753 2646 ASSERT(MUTEX_HELD(&ttoproc(t)->p_lock));
2754 2647
2755 2648 return (fss_maxumdpri / 2);
2756 2649 }
2757 2650
2758 2651 /*
2759 2652 * Called from the yield(2) system call when a thread is yielding (surrendering)
2760 2653 * the processor. The kernel thread is placed at the back of a dispatch queue.
2761 2654 */
2762 2655 static void
2763 2656 fss_yield(kthread_t *t)
2764 2657 {
2765 2658 fssproc_t *fssproc = FSSPROC(t);
2766 2659
2767 2660 ASSERT(t == curthread);
2768 2661 ASSERT(THREAD_LOCK_HELD(t));
2769 2662
2770 2663 /*
2771 2664 * Collect CPU usage spent before yielding
2772 2665 */
2773 2666 (void) CPUCAPS_CHARGE(t, &fssproc->fss_caps, CPUCAPS_CHARGE_ENFORCE);
2774 2667
2775 2668 /*
2776 2669 * Clear the preemption control "yield" bit since the user is
2777 2670 * doing a yield.
2778 2671 */
2779 2672 if (t->t_schedctl)
2780 2673 schedctl_set_yield(t, 0);
2781 2674 /*
2782 2675 * If fss_preempt() artifically increased the thread's priority
2783 2676 * to avoid preemption, restore the original priority now.
2784 2677 */
2785 2678 if (fssproc->fss_flags & FSSRESTORE) {
2786 2679 THREAD_CHANGE_PRI(t, fssproc->fss_scpri);
2787 2680 fssproc->fss_flags &= ~FSSRESTORE;
2788 2681 }
2789 2682 if (fssproc->fss_timeleft < 0) {
2790 2683 /*
2791 2684 * Time slice was artificially extended to avoid preemption,
2792 2685 * so pretend we're preempting it now.
2793 2686 */
2794 2687 DTRACE_SCHED1(schedctl__yield, int, -fssproc->fss_timeleft);
2795 2688 fssproc->fss_timeleft = fss_quantum;
2796 2689 }
2797 2690 fssproc->fss_flags &= ~FSSBACKQ;
2798 2691 setbackdq(t);
2799 2692 }
2800 2693
2801 2694 void
2802 2695 fss_changeproj(kthread_t *t, void *kp, void *zp, fssbuf_t *projbuf,
2803 2696 fssbuf_t *zonebuf)
2804 2697 {
2805 2698 kproject_t *kpj_new = kp;
2806 2699 zone_t *zone = zp;
2807 2700 fssproj_t *fssproj_old, *fssproj_new;
2808 2701 fsspset_t *fsspset;
2809 2702 kproject_t *kpj_old;
2810 2703 fssproc_t *fssproc;
2811 2704 fsszone_t *fsszone_old, *fsszone_new;
2812 2705 int free = 0;
2813 2706 int id;
2814 2707
2815 2708 ASSERT(MUTEX_HELD(&cpu_lock));
2816 2709 ASSERT(MUTEX_HELD(&pidlock));
2817 2710 ASSERT(MUTEX_HELD(&ttoproc(t)->p_lock));
2818 2711
2819 2712 if (t->t_cid != fss_cid)
2820 2713 return;
2821 2714
2822 2715 fssproc = FSSPROC(t);
2823 2716 mutex_enter(&fsspsets_lock);
2824 2717 fssproj_old = FSSPROC2FSSPROJ(fssproc);
2825 2718 if (fssproj_old == NULL) {
2826 2719 mutex_exit(&fsspsets_lock);
2827 2720 return;
2828 2721 }
2829 2722
2830 2723 fsspset = FSSPROJ2FSSPSET(fssproj_old);
2831 2724 mutex_enter(&fsspset->fssps_lock);
2832 2725 kpj_old = FSSPROJ2KPROJ(fssproj_old);
2833 2726 fsszone_old = fssproj_old->fssp_fsszone;
2834 2727
2835 2728 ASSERT(t->t_cpupart == fsspset->fssps_cpupart);
2836 2729
2837 2730 if (kpj_old == kpj_new) {
2838 2731 mutex_exit(&fsspset->fssps_lock);
2839 2732 mutex_exit(&fsspsets_lock);
2840 2733 return;
2841 2734 }
2842 2735
2843 2736 if ((fsszone_new = fss_find_fsszone(fsspset, zone)) == NULL) {
2844 2737 /*
2845 2738 * If the zone for the new project is not currently active on
2846 2739 * the cpu partition we're on, get one of the pre-allocated
2847 2740 * buffers and link it in our per-pset zone list. Such buffers
2848 2741 * should already exist.
2849 2742 */
2850 2743 for (id = 0; id < zonebuf->fssb_size; id++) {
2851 2744 if ((fsszone_new = zonebuf->fssb_list[id]) != NULL) {
2852 2745 fss_insert_fsszone(fsspset, zone, fsszone_new);
2853 2746 zonebuf->fssb_list[id] = NULL;
2854 2747 break;
2855 2748 }
2856 2749 }
2857 2750 }
2858 2751 ASSERT(fsszone_new != NULL);
2859 2752 if ((fssproj_new = fss_find_fssproj(fsspset, kpj_new)) == NULL) {
2860 2753 /*
2861 2754 * If our new project is not currently running
2862 2755 * on the cpu partition we're on, get one of the
2863 2756 * pre-allocated buffers and link it in our new cpu
2864 2757 * partition doubly linked list. Such buffers should already
2865 2758 * exist.
2866 2759 */
2867 2760 for (id = 0; id < projbuf->fssb_size; id++) {
2868 2761 if ((fssproj_new = projbuf->fssb_list[id]) != NULL) {
2869 2762 fss_insert_fssproj(fsspset, kpj_new,
2870 2763 fsszone_new, fssproj_new);
2871 2764 projbuf->fssb_list[id] = NULL;
2872 2765 break;
2873 2766 }
2874 2767 }
2875 2768 }
2876 2769 ASSERT(fssproj_new != NULL);
2877 2770
2878 2771 thread_lock(t);
2879 2772 if (t->t_state == TS_RUN || t->t_state == TS_ONPROC ||
2880 2773 t->t_state == TS_WAIT)
2881 2774 fss_inactive(t);
2882 2775 ASSERT(fssproj_old->fssp_threads > 0);
2883 2776 if (--fssproj_old->fssp_threads == 0) {
2884 2777 fss_remove_fssproj(fsspset, fssproj_old);
2885 2778 free = 1;
2886 2779 }
2887 2780 fssproc->fss_proj = fssproj_new;
2888 2781 fssproc->fss_fsspri = 0;
2889 2782 fssproj_new->fssp_threads++;
2890 2783 if (t->t_state == TS_RUN || t->t_state == TS_ONPROC ||
2891 2784 t->t_state == TS_WAIT)
2892 2785 fss_active(t);
2893 2786 thread_unlock(t);
2894 2787 if (free) {
2895 2788 if (fsszone_old->fssz_nproj == 0)
2896 2789 kmem_free(fsszone_old, sizeof (fsszone_t));
2897 2790 kmem_free(fssproj_old, sizeof (fssproj_t));
2898 2791 }
2899 2792
2900 2793 mutex_exit(&fsspset->fssps_lock);
2901 2794 mutex_exit(&fsspsets_lock);
2902 2795 }
2903 2796
2904 2797 void
2905 2798 fss_changepset(kthread_t *t, void *newcp, fssbuf_t *projbuf,
2906 2799 fssbuf_t *zonebuf)
2907 2800 {
2908 2801 fsspset_t *fsspset_old, *fsspset_new;
2909 2802 fssproj_t *fssproj_old, *fssproj_new;
2910 2803 fsszone_t *fsszone_old, *fsszone_new;
2911 2804 fssproc_t *fssproc;
2912 2805 kproject_t *kpj;
2913 2806 zone_t *zone;
2914 2807 int id;
2915 2808
2916 2809 ASSERT(MUTEX_HELD(&cpu_lock));
2917 2810 ASSERT(MUTEX_HELD(&pidlock));
2918 2811 ASSERT(MUTEX_HELD(&ttoproc(t)->p_lock));
2919 2812
2920 2813 if (t->t_cid != fss_cid)
2921 2814 return;
2922 2815
2923 2816 fssproc = FSSPROC(t);
2924 2817 zone = ttoproc(t)->p_zone;
2925 2818 mutex_enter(&fsspsets_lock);
2926 2819 fssproj_old = FSSPROC2FSSPROJ(fssproc);
2927 2820 if (fssproj_old == NULL) {
2928 2821 mutex_exit(&fsspsets_lock);
2929 2822 return;
2930 2823 }
2931 2824 fsszone_old = fssproj_old->fssp_fsszone;
2932 2825 fsspset_old = FSSPROJ2FSSPSET(fssproj_old);
2933 2826 kpj = FSSPROJ2KPROJ(fssproj_old);
2934 2827
2935 2828 if (fsspset_old->fssps_cpupart == newcp) {
2936 2829 mutex_exit(&fsspsets_lock);
2937 2830 return;
2938 2831 }
2939 2832
2940 2833 ASSERT(ttoproj(t) == kpj);
2941 2834
2942 2835 fsspset_new = fss_find_fsspset(newcp);
2943 2836
2944 2837 mutex_enter(&fsspset_new->fssps_lock);
2945 2838 if ((fsszone_new = fss_find_fsszone(fsspset_new, zone)) == NULL) {
2946 2839 for (id = 0; id < zonebuf->fssb_size; id++) {
2947 2840 if ((fsszone_new = zonebuf->fssb_list[id]) != NULL) {
2948 2841 fss_insert_fsszone(fsspset_new, zone,
2949 2842 fsszone_new);
2950 2843 zonebuf->fssb_list[id] = NULL;
2951 2844 break;
2952 2845 }
2953 2846 }
2954 2847 }
2955 2848 ASSERT(fsszone_new != NULL);
2956 2849 if ((fssproj_new = fss_find_fssproj(fsspset_new, kpj)) == NULL) {
2957 2850 for (id = 0; id < projbuf->fssb_size; id++) {
2958 2851 if ((fssproj_new = projbuf->fssb_list[id]) != NULL) {
2959 2852 fss_insert_fssproj(fsspset_new, kpj,
2960 2853 fsszone_new, fssproj_new);
2961 2854 projbuf->fssb_list[id] = NULL;
2962 2855 break;
2963 2856 }
2964 2857 }
2965 2858 }
2966 2859 ASSERT(fssproj_new != NULL);
2967 2860
2968 2861 fssproj_new->fssp_threads++;
2969 2862 thread_lock(t);
2970 2863 if (t->t_state == TS_RUN || t->t_state == TS_ONPROC ||
2971 2864 t->t_state == TS_WAIT)
2972 2865 fss_inactive(t);
2973 2866 fssproc->fss_proj = fssproj_new;
2974 2867 fssproc->fss_fsspri = 0;
2975 2868 if (t->t_state == TS_RUN || t->t_state == TS_ONPROC ||
2976 2869 t->t_state == TS_WAIT)
2977 2870 fss_active(t);
2978 2871 thread_unlock(t);
2979 2872 mutex_exit(&fsspset_new->fssps_lock);
2980 2873
2981 2874 mutex_enter(&fsspset_old->fssps_lock);
2982 2875 if (--fssproj_old->fssp_threads == 0) {
2983 2876 fss_remove_fssproj(fsspset_old, fssproj_old);
2984 2877 if (fsszone_old->fssz_nproj == 0)
2985 2878 kmem_free(fsszone_old, sizeof (fsszone_t));
2986 2879 kmem_free(fssproj_old, sizeof (fssproj_t));
2987 2880 }
2988 2881 mutex_exit(&fsspset_old->fssps_lock);
2989 2882
2990 2883 mutex_exit(&fsspsets_lock);
2991 2884 }
|
↓ open down ↓ |
335 lines elided |
↑ open up ↑ |
XXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXX